Griffithazanone A

Catalog Number	ACM240122309
CAS Number	240122-30-9
Structure
Synonyms	(3R,4R)-3,4-Dihydro-3-hydroxy-4-methylbenzo[g]quinoline-2,5,10(1H)-trione
Molecular Weight	257.24
InChI	InChI=1S/C14H11NO4/c1-6-9-10(15-14(19)11(6)16)13(18)8-5-3-2-4-7(8)12(9)17/h2-6,11,16H,1H3,(H,15,19)/t6-,11-/m1/s1
InChI Key	SZPJSZDUSLSXDF-KSBSHMNSSA-N
Purity	95%+
Complexity	508
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	257.06880783
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@H]1[C@H](C(=O)NC2=C1C(=O)C3=CC=CC=C3C2=O)O
Monoisotopic Mass	257.06880783
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	83.5 Ų

Custom Q&A

What is the chemical formula of Griffithazanone A?

The chemical formula of Griffithazanone A is C14H11NO4.

What is the molecular weight of Griffithazanone A?

The molecular weight of Griffithazanone A is 257.24 g/mol.

What is the CAS number of Griffithazanone A?

The CAS number of Griffithazanone A is 240122-30-9.

What is the melting point of Griffithazanone A?

The melting point of Griffithazanone A is 208-210 °C.

What is the predicted boiling point of Griffithazanone A?

The predicted boiling point of Griffithazanone A is 560.6±50.0 °C.

What is the predicted density of Griffithazanone A?

The predicted density of Griffithazanone A is 1.47±0.1 g/cm3.

What is the predicted pKa value of Griffithazanone A?

The predicted pKa value of Griffithazanone A is 10.22±0.60.

What are some synonyms for Griffithazanone A?

Some synonyms for Griffithazanone A include (3R,4R)-3,4-Dihydro-3-hydroxy-4-methylbenzo[g]quinoline-2,5,10(1H)-trione and Benzo[g]quinoline-2,5,10(1H)-trione, 3,4-dihydro-3-hydroxy-4-methyl-, (3R,4R)-.

How does the molecular weight of Griffithazanone A compare to other compounds?

The molecular weight of Griffithazanone A is 257.24 g/mol, which is relatively low compared to many other compounds.

Why is Griffithazanone A of interest in chemical research?

Griffithazanone A is of interest in chemical research due to its unique chemical properties, such as its structure and predicted pKa value, which may make it useful for various applications in pharmaceuticals and materials science.

※ Please kindly note that our products are for research use only.