Griffithinam

Catalog Number	ACM240122321
CAS Number	240122-32-1
Synonyms	1-Hydroxy-2,7-dimethoxydibenz[cd,f]indol-4(5H)-one
Molecular Weight	295.29
InChI	InChI=1S/C17H13NO4/c1-21-12-5-3-4-8-9(12)6-11-14-10(17(20)18-11)7-13(22-2)16(19)15(8)14/h3-7,19H,1-2H3,(H,18,20)
InChI Key	QKAHURDEAZTVNH-UHFFFAOYSA-N
Melting Point	262-264 °C
Purity	95%+
Complexity	456
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	295.0844579
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Monoisotopic Mass	295.0844579
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	67.8 Ų

Custom Q&A

What is the chemical name of GriffithinaM?

The chemical name of GriffithinaM is 1-Hydroxy-2,7-dimethoxydibenz[cd,f]indol-4(5H)-one.

What are some synonyms for GriffithinaM?

Some synonyms for GriffithinaM include Cheliensisame A, Gonioffithine I, and Uvarilactam.

What is the CAS number for GriffithinaM?

The CAS number for GriffithinaM is 240122-32-1.

What is the molecular formula of GriffithinaM?

The molecular formula of GriffithinaM is C17H13NO4.

What is the molecular weight of GriffithinaM?

The molecular weight of GriffithinaM is 295.29 g/mol.

What is the melting point of GriffithinaM?

The melting point of GriffithinaM is 262-264 °C.

What is the predicted boiling point of GriffithinaM?

The predicted boiling point of GriffithinaM is 488.4±45.0 °C.

What is the predicted density of GriffithinaM?

The predicted density of GriffithinaM is 1.419±0.06 g/cm3.

What is the predicted pka of GriffithinaM?

The predicted pka of GriffithinaM is 8.27±0.20.

※ Please kindly note that our products are for research use only.