Guanosine

Catalog Number	ACM118003-1
CAS Number	118-00-3
Structure
Synonyms	Guanine riboside
IUPAC Name	2-Amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one
Molecular Weight	283.24
Molecular Formula	C10H13N5O5
Canonical SMILES	C1=NC2=C(N1C3C(C(C(O3)CO)O)O)N=C(NC2=O)N
InChI	InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6-,9-/m1/s1
InChI Key	NYHBQMYGNKIUIF-UUOKFMHZSA-N
Purity	98%+(HPLC)
Solubility	Soluble in warm water, insoluble in cold water.
Appearance	White crystals
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	446
Exact Mass	283.09166853
Heavy Atom Count	20
Isomeric SMILES	C1=NC2=C(N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N=C(NC2=O)N
Monoisotopic Mass	283.09166853
Topological Polar Surface Area	155Ų

Custom Q&A

What is the chemical formula of Guanosine?

The chemical formula of Guanosine is C10H13N5O5.

What are some synonyms for Guanosine?

Some synonyms for Guanosine include D-Guanosine, GR, and Guanine-9-Beta-D-Ribofuranoside.

What is the melting point of Guanosine?

The melting point of Guanosine is 250 °C (dec.) (lit.).

What are some hazards associated with Guanosine?

Guanosine is classified as being irritant and can pose hazard codes T and Xi.

How is Guanosine used in cell culture applications?

Guanosine is used in cell culture applications as a precursor of GMP.

What is the general description of Guanosine?

Guanosine is described as an aromatic organic molecule and a purine nucleoside that is present in the cerebrospinal fluid, intestinal cells, blood-brain barrier, and in brain microvessels.

What are some chemical properties of Guanosine?

Guanosine is a white, crystalline powder with an odorless and mild saline taste. It is very slightly soluble in cold water, soluble in boiling water, dilute mineral acids, hot acetic acid, and dilute bases, and insoluble in alcohol, ether, chloroform, and benzene.

How is Guanosine thought to have neuroprotective properties?

Guanosine is thought to reduce neuroinflammation, oxidative stress, and excitotoxicity, as well as exerting trophic effects in neuronal and glial cells.

What are some uses of Guanosine?

Guanosine is used as a constituent of nucleic acids, in metallic paints, simulated pearls, plastics, the cosmetics industry, and in pharmacokinetics as a prodrug.

What is the significance of guanosine derivatives such as GMP and GTP?

Guanosine derivatives like GMP and GTP are essential for various biochemical processes, such as the synthesis of nucleic acids and proteins, photosynthesis, muscle contraction, and intracellular signal transduction.

※ Please kindly note that our products are for research use only.