Guvacine

Catalog Number	ACM498964-1
CAS Number	498-96-4
Structure
Synonyms	1,2,5,6-Tetrahydro-3-pyridinecarboxylic acid
IUPAC Name	I1,2,3,6-Tetrahydropyridine-5-carboxylic acid
Molecular Weight	163.6
Molecular Formula	C6H10ClNO2
Canonical SMILES	C1CNCC(=C1)C(=O)O
InChI	InChI=1S/C6H9NO2/c8-6(9)5-2-1-3-7-4-5/h2,7H,1,3-4H2,(H,8,9)
InChI Key	QTDZOWFRBNTPQR-UHFFFAOYSA-N
Boiling Point	236 °C
Melting Point	295 °C
Purity	98%
Density	1.19 g/ml
Appearance	Powder
Complexity	151
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	127.06332853
Heavy Atom Count	9
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	127.06332853
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	49.3 Ų

Custom Q&A

What is the chemical formula of Guvacine Hydrochloride?

The chemical formula of Guvacine Hydrochloride is C6H9NO2.

What is the molecular weight of Guvacine Hydrochloride?

The molecular weight of Guvacine Hydrochloride is 127.14.

What are some synonyms for Guvacine Hydrochloride?

Some synonyms for Guvacine Hydrochloride are 1,2,5,6-tetrahydro-3-pyridinecarboxylic acid and 1,2,5,6-Tetrahydropyridine-3-carboxylic acid.

What is the boiling point of Guvacine Hydrochloride?

The boiling point of Guvacine Hydrochloride is approximately 235.91°C.

What is the melting point of Guvacine Hydrochloride?

The melting point of Guvacine Hydrochloride is estimated to be 295°C.

What is the solubility of Guvacine Hydrochloride in water?

Guvacine Hydrochloride is soluble in water.

What is the hazard code associated with Guvacine Hydrochloride?

The hazard code for Guvacine Hydrochloride is Xi.

What is the specific biological activity of Guvacine Hydrochloride?

Guvacine Hydrochloride is a specific GABA uptake inhibitor.

In what ways can Guvacine Hydrochloride be used?

Guvacine Hydrochloride can be used as a GABA uptake inhibitor for treating neuropsychiatric disorders.

What is the storage recommendation for Guvacine Hydrochloride?

Guvacine Hydrochloride should be stored at room temperature.

※ Please kindly note that our products are for research use only.