Guvacine hydrochloride

Catalog Number	ACM6027914-1
CAS Number	6027-91-4
Structure
Synonyms	1,2,5,6-Tetrahydro-3-pyridinecarboxylic acid hydrochloride
Molecular Weight	163.6
InChI	InChI=1S/C6H9NO2.ClH/c8-6(9)5-2-1-3-7-4-5;/h2,7H,1,3-4H2,(H,8,9);1H
InChI Key	FGNUNVVTHHKDAM-UHFFFAOYSA-N
Melting Point	316 °C
Purity	95%+
Complexity	151
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	0
Exact Mass	163.0400063
Heavy Atom Count	10
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	3
Monoisotopic Mass	163.0400063
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	49.3 Ų

Custom Q&A

What is the chemical formula of Guvacine hydrochloride?

The chemical formula of Guvacine hydrochloride is C6H10ClNO2.

What is the molecular weight of Guvacine hydrochloride?

The molecular weight of Guvacine hydrochloride is 163.6021.

What are the synonyms for Guvacine hydrochloride?

Some synonyms for Guvacine hydrochloride include GABA UPTAKE, 1,2,5,6-Tetrahydro-, Norareca alkaloid hydrochloride, etc.

What is the melting point of Guvacine hydrochloride?

The melting point of Guvacine hydrochloride is 316 °C (decomp).

What is the solubility of Guvacine hydrochloride in water?

Guvacine hydrochloride is soluble in water.

What is the hazard code associated with Guvacine hydrochloride?

The hazard code associated with Guvacine hydrochloride is Xi.

What is the primary biological activity of Guvacine hydrochloride?

Guvacine hydrochloride is an alkaloid that acts as an inhibitor of GABA transporter.

How does Guvacine hydrochloride affect GABA transporters?

Guvacine hydrochloride displays modest selectivity for cloned GABA transporters with specific IC50 values.

What are the potential uses of Guvacine hydrochloride?

Guvacine hydrochloride may be useful for treating neuropsychiatric disorders and neurodegenerative diseases.

What is the color and form of Guvacine hydrochloride?

Guvacine hydrochloride is in solid form and appears as white in color.

※ Please kindly note that our products are for research use only.