Gynuramine

Catalog Number	ACM85611434
CAS Number	85611-43-4
Synonyms	19-Hydroxysenecionine
Molecular Weight	351.4
InChI	InChI=1S/C18H25NO6/c1-3-11-8-13(9-20)18(2,23)17(22)24-10-12-4-6-19-7-5-14(15(12)19)25-16(11)21/h3-4,13-15,20,23H,5-10H2,1-2H3/b11-3-/t13-,14+,15+,18+/m0/s1
InChI Key	XVKRSUITGOSAJK-WXVZNDRCSA-N
Purity	95%+
Complexity	627
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	351.16818752
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C\1/C[C@H]([C@@](C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC1=O)(C)O)CO
Monoisotopic Mass	351.16818752
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	96.3 Ų

Custom Q&A

What is the chemical name of 19-hydroxysenecionine?

The chemical name of 19-hydroxysenecionine is Senecionan-11,16-dione, 12,19-dihydroxy.

What is another name for 19-hydroxysenecionine?

Another name for 19-hydroxysenecionine is Gynuramine.

What is the CAS number of 19-hydroxysenecionine?

The CAS number of 19-hydroxysenecionine is 85611-43-4.

What is the molecular formula of 19-hydroxysenecionine?

The molecular formula of 19-hydroxysenecionine is C18H25NO6.

What is the molecular weight of 19-hydroxysenecionine?

The molecular weight of 19-hydroxysenecionine is 351.39.

What is the predicted boiling point of 19-hydroxysenecionine?

The predicted boiling point of 19-hydroxysenecionine is 610.0 ±55.0 °C.

What is the predicted density of 19-hydroxysenecionine?

The predicted density of 19-hydroxysenecionine is 1.32 ±0.1 g/cm3.

What is the predicted pka value of 19-hydroxysenecionine?

The predicted pka value of 19-hydroxysenecionine is 12.57 ±0.40.

What type of compound is 19-hydroxysenecionine?

19-hydroxysenecionine is a chemical compound.

※ Please kindly note that our products are for research use only.