Haemanthamine

Catalog Number	ACM466751
CAS Number	466-75-1
Description	Haemanthamine is a crinine-type alkaloid isolated from the Amaryllidaceae plants with potent anticancer activity. Haemanthamine targets ribosomal that inhibits protein biosynthesis during the elongation stage of translation. Haemanthamine has pro-apoptotic, antioxidant, antiviral, antimalarial and anticonvulsant activities.
Synonyms	3-Epicrinamine
Molecular Weight	301.34
Molecular Formula	C17H19NO4
Canonical SMILES	O[C@@H](C1)[C@@]2(C=C3)C4=CC(OCO5)=C5C=C4C[N@@]1[C@@]2([H])C[C@@H]3OC
InChI	InChI=1S/C17H19NO4/c1-20-11-2-3-17-12-6-14-13(21-9-22-14)4-10(12)7-18(8-16(17)19)15(17)5-11/h2-4,6,11,15-16,19H,5,7-9H2,1H3/t11-,15+,16+,17+/m1/s1
InChI Key	YGPRSGKVLATIHT-HSHDSVGOSA-N
Purity	90%+
Appearance	Solid
Storage	Powder-20°C, 3 years; In solvent-80°C. 6 months; -20°C, 1 month.
Complexity	497
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	301.13140809
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CO[C@H]1C[C@H]2[C@@]3(C=C1)[C@H](CN2CC4=CC5=C(C=C34)OCO5)O
Monoisotopic Mass	301.13140809
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	51.2 Ų

Custom Q&A

What is the chemical name of NSC403140?

The chemical name of NSC403140 is Haemanthamine.

What is the molecular formula of Haemanthamine?

The molecular formula of Haemanthamine is C17H19NO4.

What is the storage temperature recommended for NSC403140?

The storage temperature recommended for NSC403140 is -20°C.

What is the solubility of NSC403140 in DMSO?

NSC403140 is soluble in DMSO at a concentration of 100 mg/mL.

What are some of the biological activities of Haemanthamine?

Haemanthamine has potent anticancer activity, proapoptotic, antioxidant, antiviral, antimalarial, and anticonvulsant activities.

How does Haemanthamine impact cell viability in vitro?

Haemanthamine treatment in A2780 cells showed a time- and dose-dependent decrease in cell viability.

Where does Haemanthamine bind in the ribosome to inhibit protein biosynthesis?

Haemanthamine binds at the A-site cleft of the peptidyl transferase center on the large ribosomal subunit.

What is the effect of Haemanthamine on pre-rRNA processing?

Haemanthamine has a highly specific inhibitory effect on pre-rRNA processing, leading to the activation of a p53-dependent antitumoral surveillance pathway known as nucleolar stress.

How is Haemanthamine eliminated from the body in rats?

Haemanthamine is primarily eliminated through renal elimination in rats.

How long does the plasmatic concentration of Haemanthamine remain higher than 1 μM after a single 10-mg/kg administration?

The plasmatic concentration of Haemanthamine remains higher than 1 μM for at least 1 hour after a single 10-mg/kg administration.

※ Please kindly note that our products are for research use only.