Halofuginone

Halofuginone

Inquiry
Catalog Number ACM55837202-1
CAS Number 55837-20-2
Structure
IUPAC Name 7-Bromo-6-chloro-3-[3-[(2S,3R)-3-hydroxypiperidin-2-yl]-2-oxopropyl]quinazolin-4-one
Molecular Weight 414.68
Molecular Formula C16H17BRClN3O3
Canonical SMILES C1CC(C(NC1)CC(=O)CN2C=NC3=CC(=C(C=C3C2=O)Cl)Br)O
InChI InChI=1S/C16H17BrClN3O3/c17-11-6-13-10(5-12(11)18)16(24)21(8-20-13)7-9(22)4-14-15(23)2-1-3-19-14/h5-6,8,14-15,19,23H,1-4,7H2/t14-,15+/m0/s1
InChI Key LVASCWIMLIKXLA-LSDHHAIUSA-N
Purity 98%+
Storage Store in dry, low temperature, sealed, 2-8 °C.
Complexity 533
Exact Mass 413.01418
Heavy Atom Count 24
Isomeric SMILES C1C[C@H]([C@@H](NC1)CC(=O)CN2C=NC3=CC(=C(C=C3C2=O)Cl)Br)O
Monoisotopic Mass 413.01418
Topological Polar Surface Area 82Ų
Custom Q&A

What is the synonym for Halofuginone?

The synonym for Halofuginone is 7-Bromo-6-chloro-3[3-(3-hydroxy-2-piperidinyl)-2-oxopropyl]-4(3H)-quinzolinone.

What is the molecular formula of Halofuginone?

The molecular formula of Halofuginone is C16H17BrClN3O3.

What is the solubility of Halofuginone in DMSO?

Halofuginone has a solubility of 9 mg/mL in DMSO.

What is the melting point of Halofuginone?

The melting point of Halofuginone is greater than 150°C.

What is the primary usage of Halofuginone?

Halofuginone is primarily used as a treatment or prevention of coccidiosis in both humans and animals.

How is Halofuginone extracted from enzyme-digested chicken liver?

Halofuginone is extracted from enzyme-digested chicken liver as a free base into ethyl acetate and partitioned into ammonium acetate buffer solution.

What biological activity does Halofuginone possess?

Halofuginone has antimalarial and anticoccidial actions and can block fibrosis and tumor progression in different models.

What does Halofuginone competitively inhibit?

Halofuginone competitively inhibits prolyl-tRNA synthetase, activating the amino acid starvation response.

What is the brand name under which Halofuginone is marketed?

Halofuginone is marketed under the brand name Stenorol (by Roussel-UCLAF, France).

What is the mode of action of Halofuginone in inhibiting fibrosis?

Halofuginone inhibits fibrosis by inhibiting Smad3 phosphorylation downstream of the TGFβ signaling pathway, preventing the transition of fibroblasts to myofibroblasts.

※ Please kindly note that our products are for research use only.