Haplopine

Catalog Number	ACM5876175
CAS Number	5876-17-5
Synonyms	4,8-Dimethoxyfuro[2,3-b]quinolin-7-ol
Molecular Weight	245.23
InChI	InChI=1S/C13H11NO4/c1-16-11-7-3-4-9(15)12(17-2)10(7)14-13-8(11)5-6-18-13/h3-6,15H,1-2H3
InChI Key	LJKPBWHZRNQEMO-UHFFFAOYSA-N
Melting Point	202-204 °C
Purity	95%+
Complexity	301
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	245.06880783
Heavy Atom Count	18
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Monoisotopic Mass	245.06880783
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	64.7 Ų

Custom Q&A

What is another name for 4,8-Dimethoxyfuro[2,3-b]quinolin-7-ol?

Haplopine

What is the CAS number for Haplopine?

5876-17-5

What is the molecular formula of Haplopine?

C13H11NO4

What is the melting point of Haplopine?

202-204 °C

What are the safety hazard codes associated with Haplopine?

Hazard Codes T

How does Haplopine crystallize?

It crystallizes as small colorless needles from MeOH.

What is the definition of Haplopine according to ChEBI?

Haplopine is an oxacycle, an organonitrogen heterocyclic compound and an organic heterotricyclic compound.

In which plant does Haplopine occur naturally?

H. perforatum (MB) Kar. et Kir. and in H. robustum Bge.

What is the pka value of Haplopine?

5.60±0.30 (Predicted)

How can Haplopine be isomerized?

The base may be isomerized to isohaplopine.

※ Please kindly note that our products are for research use only.