Harmalacidine

Catalog Number	ACM26579691
CAS Number	26579-69-1
Structure
Molecular Weight	216.24
InChI	InChI=1S/C12H12N2O2/c1-16-7-2-3-8-9-4-5-13-12(15)11(9)14-10(8)6-7/h2-3,6,14H,4-5H2,1H3,(H,13,15)
InChI Key	MWEGNYFSTKOOSD-UHFFFAOYSA-N
Melting Point	198 °C
Purity	95%+
Complexity	295
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	216.08987763
Heavy Atom Count	16
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	216.08987763
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	54.1 Ų

Custom Q&A

What is the chemical name of the compound with the CAS number 26579-69-1?

The chemical name is 1H-Pyrido[3,4-b]indol-1-one,2,3,4,9-tetrahydro-7-methoxy-.

What is the synonym for the compound?

The synonym for the compound is Harmalacidine.

What is the molecular formula of Harmalacidine?

The molecular formula is C12H12N2O2.

What is the molecular weight of Harmalacidine?

The molecular weight is 216.24 g/mol.

What is the melting point of Harmalacidine?

The melting point is 198 °C.

What is the predicted boiling point of Harmalacidine?

The predicted boiling point is 549.2 ± 50.0 °C.

What is the predicted density of Harmalacidine?

The predicted density is 1.308 ± 0.06 g/cm3.

What is the predicted pKa value of Harmalacidine?

The predicted pKa is 15.33 ± 0.20.

How many nitrogen atoms are present in the molecular formula of Harmalacidine?

There are two nitrogen atoms present.

※ Please kindly note that our products are for research use only.