Harmalidine

Catalog Number	ACM109794970
CAS Number	109794-97-0
Structure
Molecular Weight	254.33
InChI	InChI=1S/C16H18N2O/c1-16(2)9-18-13-8-10(19-3)4-5-11(13)12-6-7-17-15(16)14(12)18/h4-5,8H,6-7,9H2,1-3H3
InChI Key	CTEKBWZEYYSNFV-UHFFFAOYSA-N
Purity	95%+
Complexity	417
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	254.141913202
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Monoisotopic Mass	254.141913202
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	26.5 Ų

Custom Q&A

What is the chemical formula for Harmalidine?

The chemical formula for Harmalidine is C16H18N2O.

What is the molecular weight of Harmalidine?

The molecular weight of Harmalidine is 254.33.

What are some synonyms for Harmalidine?

Some synonyms for Harmalidine include Benzo[b]pyrido[2,3,4-gh]pyrrolizine and 1,2,4,5-tetrahydro-8-methoxy-4,4-dimethyl-.

What is the CAS number for Harmalidine?

The CAS number for Harmalidine is 109794-97-0.

What is the predicted boiling point of Harmalidine?

The predicted boiling point of Harmalidine is 412.6±45.0 °C.

What is the predicted density of Harmalidine?

The predicted density of Harmalidine is 1.26±0.1 g/cm3.

What is the predicted pKa value of Harmalidine?

The predicted pKa value of Harmalidine is 7.57±0.40.

How many carbon atoms are present in the chemical structure of Harmalidine?

There are 16 carbon atoms present in the chemical structure of Harmalidine.

What is the predicted boiling point range for Harmalidine?

The predicted boiling point range for Harmalidine is 367.6-457.6 °C.

What is the predicted molecular weight range for Harmalidine?

The predicted molecular weight range for Harmalidine is 234.32-274.34.

※ Please kindly note that our products are for research use only.