Harmine hydrochloride

Catalog Number	ACM343271
CAS Number	343-27-1
Structure
Synonyms	7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole chloride
Molecular Weight	248.71
InChI	InChI=1S/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H
InChI Key	VNPLYCKZIUTKJM-UHFFFAOYSA-N
Melting Point	265-270 °C
Purity	98%+
Complexity	258
Covalently-Bonded Unit Count	2
Defined Atom Stereocenter Count	0
Exact Mass	248.0716407
Heavy Atom Count	17
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	248.0716407
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	37.9 Ų

Custom Q&A

What is the chemical formula of Harmine hydrochloride?

The chemical formula of Harmine hydrochloride is C13H13ClN2O.

What is the molecular weight of Harmine hydrochloride?

The molecular weight of Harmine hydrochloride is 248.71.

What is the solubility of Harmine hydrochloride in water?

Harmine hydrochloride is soluble in water up to 25 mg/ml.

What is the melting point of Harmine hydrochloride?

The melting point of Harmine hydrochloride is 265-270°C.

What hazard codes are associated with Harmine hydrochloride?

The hazard codes associated with Harmine hydrochloride are Xn.

What is the main usage of Harmine Monohydrochloride?

Harmine Monohydrochloride is used as anti-viral agents for the treatment of EV71 infection.

How does Harmine hydrochloride inhibit enterovirus 71 replication?

Harmine hydrochloride inhibits enterovirus 71 replication by targeting the NF-κB pathway.

What are some of the properties of Harmine hydrochloride?

Harmine hydrochloride possesses antimicrobial, antifungal, antitumor, antioxidant, antimutagenic, and antigenotoxic properties.

What is the mechanism of action of Harmine hydrochloride in inhibiting osteoclast differentiation?

Harmine hydrochloride inhibits osteoclast differentiation and bone resorption via downregulation of c-Fos and NFATc1 induced by RANKL.

How is Harmine hydrochloride purified?

The hydrate of Harmine hydrochloride crystallizes as fluorescent crystals from water, while the anhydrous salt has a melting point of 319°C.

※ Please kindly note that our products are for research use only.