Harmol

Catalog Number	ACM487036-1
CAS Number	487-03-6
Structure
Synonyms	1-Methyl-9H-pyrido[3,4-b]indol-7-ol
Molecular Weight	198.22
Molecular Formula	C12H10N2O
Canonical SMILES	OC1=CC2=C(C=C1)C3=C(C(C)=NC=C3)N2
InChI	InChI=1S/C12H10N2O/c1-7-12-10(4-5-13-7)9-3-2-8(15)6-11(9)14-12/h2-6,13-14H,1H3
InChI Key	LBBJNGFCXDOYMQ-UHFFFAOYSA-N
Melting Point	231 °C
Purity	99%+
Appearance	Off-white to light yellow solid
Storage	Powder: -20 °C, 3 years In solvent: -80 °C, 6 months; -20 °C, 1 month
Complexity	516
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	198.079312947
Heavy Atom Count	15
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	198.079312947
PhysicalState	Solid
Rotatable Bond Count	0
Topological Polar Surface Area	41.1 Ų

Custom Q&A

What is the chemical formula of HARMOL?

The chemical formula of HARMOL is C12H10N2O.

What is the molecular weight of HARMOL?

The molecular weight of HARMOL is 198.22 g/mol.

What is the melting point of HARMOL?

The melting point of HARMOL is 231°C.

What is the boiling point of HARMOL?

The boiling point of HARMOL is predicted to be 460.4±40.0 °C.

In what type of solvents is HARMOL slightly soluble?

HARMOL is slightly soluble in DMSO (heated) and Methanol.

What are the safety hazard codes associated with HARMOL?

The hazard code for HARMOL is Xn.

What are the risk statements associated with HARMOL?

The risk statements for HARMOL are 20/21/22.

What are the major microspecies of HARMOL at pH 7.3?

The major microspecies of HARMOL at pH 7.3 are Harmol with a methyl substituent at C-1 and a hydroxy group at C-7.

What roles does HARMOL play in biological processes?

HARMOL acts as an antifungal agent, an apoptosis inducer, and an autophagy inducer.

How is HARMOL related in function to a beta-carboline?

HARMOL is functionally related to a beta-carboline as it is a harmala alkaloid and an indole alkaloid.

※ Please kindly note that our products are for research use only.