Harzianic acid

Catalog Number	ACM157148066
CAS Number	157148-06-6
Structure
Molecular Weight	365.4
Molecular Formula	C19H27NO6
InChI	InChI=1S/C19H27NO6/c1-5-6-7-8-9-10-14(21)15-16(22)13(20(4)17(15)23)11-19(26,12(2)3)18(24)25/h7-10,12-13,21,26H,5-6,11H2,1-4H3,(H,24,25)/b8-7+,10-9+,15-14+
InChI Key	FQSWTHMMNDRFAI-RFJZBCCMSA-N
Purity	95%+
Complexity	661
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	365.18383758
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	3
Isomeric SMILES	CCC/C=C/C=C/C(=C\1/C(=O)C(N(C1=O)C)CC(C(C)C)(C(=O)O)O)/O
Monoisotopic Mass	365.18383758
PhysicalState	Powder
Rotatable Bond Count	8
Topological Polar Surface Area	115 Ų

Custom Q&A

What is the chemical formula for harzianic acid?

The chemical formula for harzianic acid is C19H27NO6.

What is the molecular weight of harzianic acid?

The molecular weight of harzianic acid is 365.42 g/mol.

What is the melting point of harzianic acid?

The melting point of harzianic acid is 85-86°C.

In what solvents is harzianic acid soluble?

Harzianic acid is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What activity does harzianic acid show in terms of plant growth?

Harzianic acid shows plant growth promotion activity.

What type of secondary metabolite is harzianic acid?

Harzianic acid is a Trichoderma secondary metabolite.

What type of activity does harzianic acid exhibit against certain fungi?

Harzianic acid has antifungal activity and antibiotic activity against Pythium irregulare, Sclerotinia sclerotiorum, and Rhizoctonia solani.

What is the predicted boiling point of harzianic acid?

The predicted boiling point of harzianic acid is 619.6±55.0°C.

What is the predicted pKa value of harzianic acid?

The predicted pKa value of harzianic acid is 3.75±0.32.

What is the physical form of harzianic acid?

Harzianic acid is in powder form.

※ Please kindly note that our products are for research use only.