Hecubine

Catalog Number	ACM62874526
CAS Number	62874-52-6
Synonyms	(1aR,13S,13aS)-13-Ethyl-1a,4,5,10,11,12,13,13a-octahydro-10-methyl-2H-3,13-methanooxireno[9,10]azacycloundecino[5,4-b]indole
Molecular Weight	310.4
InChI	InChI=1S/C20H26N2O/c1-3-20-10-8-17-15(14-6-4-5-7-16(14)21(17)2)9-11-22(13-20)12-18-19(20)23-18/h4-7,18-19H,3,8-13H2,1-2H3/t18-,19-,20+/m1/s1
InChI Key	XUDAGNVXWJRKJD-AQNXPRMDSA-N
Purity	90%+
Complexity	469
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	310.204513457
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	0
Isomeric SMILES	CC[C@]12CCC3=C(CCN(C1)C[C@@H]4[C@H]2O4)C5=CC=CC=C5N3C
Monoisotopic Mass	310.204513457
PhysicalState	Oil
Rotatable Bond Count	1
Topological Polar Surface Area	20.7 Ų

Custom Q&A

What is the chemical name of Hecubine?

The chemical name of Hecubine is (1aR,13S,13aS)-13-Ethyl-1a,4,5,10,11,12,13,13a-octahydro-10-methyl-2H-3,13-methanooxireno[9,10]azacycloundecino[5,4-b]indole.

What are some synonyms for Hecubine (1aR,13S,13aS)-13-Ethyl-1a,4,5,10,11,12,13,13a-octahydro-10-methyl-2H-3,13-methanooxireno[9,10]azacycloundecino[5,4-b]indole?

Some synonyms for Hecubine include Hecubine and 1aH-3,13-Methanooxireno[9,10]azacycloundecino[5,4-b]indole, 13-ethyl-2,4,5,10,11,12,13,13a-octahydro-10-methyl-, (1aR,3R,13S,13aS)-.

What is the molecular formula of (1aR,13S,13aS)-13-Ethyl-1a,4,5,10,11,12,13,13a-octahydro-10-methyl-2H-3,13-methanooxireno[9,10]azacycloundecino[5,4-b]indole?

The molecular formula is C20H26N2O.

What is the molecular weight of Hecubine?

The molecular weight is 310.43 g/mol.

What is the predicted boiling point of Hecubine?

The predicted boiling point is 473.2±45.0 °C.

What is the predicted density of Hecubine?

The predicted density is 1.27±0.1 g/cm3.

What is the predicted pka value of Hecubine?

The predicted pka value is 8.81±0.40.

In what plant can hecubine be found naturally?

Hecubine can be found in the extract of Ervatarnia coronaria grown in Cuba.

In what solvent does hecubine form colorless crystals?

Hecubine forms colorless crystals from MeOH (methanol).

What type of compound is hecubine?

Hecubine is an epoxy alkaloid.

※ Please kindly note that our products are for research use only.