Heliocurassavicine

Catalog Number	ACM82354345
CAS Number	82354-34-5
Molecular Weight	285.38
InChI	InChI=1S/C15H27NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h10-13,17,19H,4-9H2,1-3H3/t11-,12+,13-,15+/m0/s1
InChI Key	BWQSLRZZOVFVHJ-SFDCQRBFSA-N
Purity	95%+
Complexity	360
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	285.19400834
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@@H]([C@](C(C)C)(C(=O)OC[C@H]1CCN2[C@H]1CCC2)O)O
Monoisotopic Mass	285.19400834
PhysicalState	Powder
Rotatable Bond Count	6
Topological Polar Surface Area	70 Ų

Custom Q&A

What is the chemical formula for Heliocurassavicine?

The chemical formula for Heliocurassavicine is C15H27NO4.

What is the molecular weight of Heliocurassavicine?

The molecular weight of Heliocurassavicine is 285.38 g/mol.

What is the CAS number for Heliocurassavicine?

The CAS number for Heliocurassavicine is 82354-34-5.

What are some synonyms for Heliocurassavicine?

Some synonyms for Heliocurassavicine are Heliocurassavicine; Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, [(1S,7aS)-hexahydro-1H-pyrrolizin-1-yl]methyl ester, (2R,3S)-.

What is the predicted boiling point of Heliocurassavicine?

The predicted boiling point of Heliocurassavicine is 413.5±14.0 °C.

What is the predicted density of Heliocurassavicine?

The predicted density of Heliocurassavicine is 1.16±0.1 g/cm3.

What is the predicted pKa value of Heliocurassavicine?

The predicted pKa value of Heliocurassavicine is 12.61±0.29.

What is the molecular formula of Heliocurassavicine?

The molecular formula of Heliocurassavicine is C15H27NO4.

What is the chemical property of Heliocurassavicine related to boiling point?

The chemical property related to the boiling point of Heliocurassavicine is 413.5±14.0 °C.

What is the chemical property of Heliocurassavicine related to density?

The chemical property related to the density of Heliocurassavicine is 1.16±0.1 g/cm3.

※ Please kindly note that our products are for research use only.