Heliosupine

Catalog Number	ACM32728782
CAS Number	32728-78-2
Structure
Synonyms	2-Methyl-2-butenoic acid 7-[[2,3-dihydroxy-2-(1-hydroxyethyl)-3-methylbutyryloxy]methyl]-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl ester
Molecular Weight	397.5
InChI	InChI=1S/C20H31NO7/c1-6-12(2)17(23)28-15-8-10-21-9-7-14(16(15)21)11-27-18(24)20(26,13(3)22)19(4,5)25/h6-7,13,15-16,22,25-26H,8-11H2,1-5H3/b12-6-/t13-,15-,16+,20+/m0/s1
InChI Key	HRSGCYGUWHGOPY-UKLMUADPSA-N
Purity	95%+
Complexity	684
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	397.21005233
Heavy Atom Count	28
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	3
Isomeric SMILES	C/C=C(/C)\C(=O)O[C@H]1CCN2[C@@H]1C(=CC2)COC(=O)[C@]([C@H](C)O)(C(C)(C)O)O
Monoisotopic Mass	397.21005233
PhysicalState	Powder
Rotatable Bond Count	9
Topological Polar Surface Area	117 Ų

Custom Q&A

What is the chemical name of Heliosupine?

The chemical name of Heliosupine is 2-Methyl-2-butenoic acid 7-[[2,3-dihydroxy-2-(1-hydroxyethyl)-3-methyl-1-oxobutoxy)methyl-2,3,5,7a-tetrahydro-1H-pyrrolizin-1-yl.

What are some synonyms of Heliosupine?

Some synonyms of Heliosupine include Cynoglossophine and Heliosupine sulfate.

What is the CAS number of Heliosupine?

The CAS number of Heliosupine is 32728-78-2.

What is the molecular formula of Heliosupine?

The molecular formula of Heliosupine is C20H31NO7.

What is the molecular weight of Heliosupine?

The molecular weight of Heliosupine is 397.46.

What is the specific rotation of Heliosupine in ethanol?

The specific rotation of Heliosupine in ethanol is alpha D20 -4.3° (c = 5.1).

How is Heliosupine defined in ChEBI?

Heliosupine is defined in ChEBI as an azabicycloalkane compound having angelyloxy and echimidinyloxymethyl substituents attached to the ring system.

What are some other chemical properties of Heliosupine?

Other chemical properties of Heliosupine include its molecular structure and the presence of specific functional groups.

How is Heliosupine used in synthesis?

Heliosupine is used in synthesis as a compound with specific substituents attached to the ring system.

※ Please kindly note that our products are for research use only.