Heliotrine N-oxide

Catalog Number	ACM6209650
CAS Number	6209-65-0
Synonyms	Heliotrine, 4-oxide
Molecular Weight	409.4
InChI	InChI=1S/C16H27NO6/c1-10(2)16(20,11(3)22-4)15(19)23-9-12-5-7-17(21)8-6-13(18)14(12)17/h5,10-11,13-14,18,20H,6-9H2,1-4H3/t11,13-,14-,16,17/m0/s1
InChI Key	QSTHEUSPIBEICI-ORJSOOTCSA-N
Purity	95%+
Complexity	493
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	329.18383758
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	2
Isomeric SMILES	CC(C)C(C(C)OC)(C(=O)OCC1=CC[N+]2([C@@H]1[C@H](CC2)O)[O-])O
Monoisotopic Mass	329.18383758
PhysicalState	Powder
Rotatable Bond Count	7
Topological Polar Surface Area	94.1 Ų

Custom Q&A

What is the chemical name for Heliotrine, 4-oxide?

The chemical name is Butanoic acid, 2-hydroxy-2-[(1R)-1-methoxyethyl]-3-methyl-, [(1S,7aR)-2,3,5,7a-tetrahydro-1-hydroxy-4-oxido-1H-pyrrolizin-7-yl]methyl ester, (2S)-.

What is the CAS number for Heliotrine, 4-oxide?

The CAS number is 6209-65-0.

What is the molecular formula of Heliotrine, 4-oxide?

The molecular formula is C16H27NO6.

What is the molecular weight of Heliotrine, 4-oxide?

The molecular weight is 329.39.

What are the chemical properties of Heliotrine, 4-oxide?

The pka is 12.08±0.29 (Predicted).

What is Heliotrine N-oxide a derivative of?

Heliotrine N-oxide is a derivative of Heliotrine.

Where can Heliotrine be found?

Heliotrine can be found in the seeds of Heliotropium indicum.

What mutagenic activity does Heliotrine exhibit?

Heliotrine exhibits mutagenic activity.

What other activity does Heliotrine exhibit?

Heliotrine exhibits ganglion blocking activity.

What is Heliotrine commonly used for in India?

Heliotrine is commonly used in India as a herb.

※ Please kindly note that our products are for research use only.