Heliovicine

Heliovicine

Inquiry
Catalog Number ACM68473858
CAS Number 68473-85-8
Structure
Synonyms (2R,3S)-2,3-Dihydroxy-2-isopropylbutanoic acid [(1R,7aS)-hexahydro-1H-pyrrolizin-1-yl]methyl ester
Molecular Weight 285.38
InChI InChI=1S/C15H27NO4/c1-10(2)15(19,11(3)17)14(18)20-9-12-6-8-16-7-4-5-13(12)16/h10-13,17,19H,4-9H2,1-3H3/t11-,12-,13-,15+/m0/s1
InChI Key BWQSLRZZOVFVHJ-PWNZVWSESA-N
Purity 95%+
Complexity 360
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 4
Exact Mass 285.19400834
Heavy Atom Count 20
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 2
Isomeric SMILES C[C@@H]([C@](C(C)C)(C(=O)OC[C@@H]1CCN2[C@H]1CCC2)O)O
Monoisotopic Mass 285.19400834
PhysicalState Powder
Rotatable Bond Count 6
Topological Polar Surface Area 70 Ų
Custom Q&A

What is the chemical name of the compound with the synonym Heliovicine?

The chemical name is (2R,3S)-2,3-Dihydroxy-2-isopropylbutanoic acid [(1R,7aS)-hexahydro-1H-pyrrolizin-1-yl]methyl ester.

What is the CAS number of Heliovicine?

The CAS number is 68473-85-8.

What is the molecular formula of Heliovicine?

The molecular formula is C15H27NO4.

What is the molecular weight of Heliovicine?

The molecular weight is 285.38.

What is the predicted boiling point of Heliovicine?

The predicted boiling point is 413.5±14.0 °C.

What is the predicted density of Heliovicine?

The predicted density is 1.16±0.1 g/cm3.

What is the predicted pka value of Heliovicine?

The predicted pka value is 12.61±0.29.

What are some synonyms of Heliovicine?

Some synonyms include Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, and (2R,3S)-.

What are the stereochemistry configurations of Heliovicine?

The stereochemistry configurations are (2R,3S) and [(1R,7aS)].

How can Heliovicine be described based on its chemical properties?

Heliovicine can be described as a compound with specific boiling point, density, and pka value, as well as a certain molecular formula and weight.

※ Please kindly note that our products are for research use only.