Hippadine

Catalog Number	ACM52886063
CAS Number	52886-06-3
Structure
Molecular Weight	263.25
InChI	InChI=1S/C16H9NO3/c18-16-12-7-14-13(19-8-20-14)6-11(12)10-3-1-2-9-4-5-17(16)15(9)10/h1-7H,8H2
InChI Key	DONUVZIVKLIMJU-UHFFFAOYSA-N
Purity	95%+
Complexity	439
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	263.058243149
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	0
Monoisotopic Mass	263.058243149
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	40.5 Ų

Custom Q&A

What is the chemical formula for hippadine?

The chemical formula for hippadine is C16H9NO3.

What is the molar mass of hippadine?

The molar mass of hippadine is 263.25 g/mol.

What is the melting point of hippadine?

The melting point of hippadine is 216-218 °C.

In what solvent is the melting point of hippadine measured?

The melting point of hippadine is measured in methanol.

What is the predicted boiling point of hippadine?

The predicted boiling point of hippadine is 422.1±45.0 °C.

What is the density of hippadine?

The density of hippadine is 1.56±0.1 g/cm3.

What is the CAS number of hippadine?

The CAS number of hippadine is 52886-06-3.

※ Please kindly note that our products are for research use only.