Homodihydrocapsaicin II

Catalog Number	ACM71239219
CAS Number	71239-21-9
Synonyms	N-(4-Hydroxy-3-methoxybenzyl)-8-methyldecanamide
IUPAC Name	N-[(4-Hydroxy-3-methoxyphenyl)methyl]-8-methyldecanamide
Molecular Weight	321.45
Molecular Formula	C19H31NO3
Canonical SMILES	CCC(C)CCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC
InChI	InChI=1S/C19H31NO3/c1-4-15(2)9-7-5-6-8-10-19(22)20-14-16-11-12-17(21)18(13-16)23-3/h11-13,15,21H,4-10,14H2,1-3H3,(H,20,22)
InChI Key	GOBFKCLUUUDTQE-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	322
Exact Mass	321.23039385
Heavy Atom Count	23
Monoisotopic Mass	321.23039385
Topological Polar Surface Area	58.6Ų

Custom Q&A

What is the chemical name of Dihydro Homocapsaicin II?

The chemical name is Decanamide, N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methyl-

What are some synonyms of Dihydro Homocapsaicin II?

Some synonyms include Capsaicin Impurity 8, Homodihydrocapsaicin II, and Capsaicin (Zucapsaicin) Impurity 8.

What is the CAS number of Dihydro Homocapsaicin II?

The CAS number is 71239-21-9.

What is the molecular formula of Dihydro Homocapsaicin II?

The molecular formula is C19H31NO3.

What is the molecular weight of Dihydro Homocapsaicin II?

The molecular weight is 321.45.

What is the predicted boiling point of Dihydro Homocapsaicin II?

The predicted boiling point is 508.0±40.0 °C.

What is the predicted density of Dihydro Homocapsaicin II?

The predicted density is 1.017±0.06 g/cm3.

What is the predicted pka value of Dihydro Homocapsaicin II?

The predicted pka value is 9.76±0.20.

What is Dihydro Homocapsaicin II commonly found in?

It is commonly found in herbs and spices such as chili peppers.

What is the relationship between Dihydro Homocapsaicin II and Homocapsaicin I?

Dihydro Homocapsaicin II is a related compound of Homocapsaicin I.

※ Please kindly note that our products are for research use only.