Homoharringtonine

Catalog Number	ACM26833874-2
CAS Number	26833-87-4
Structure
Description	Homoharringtonine is a natural compound that inhibits the DNA polymerase, which is involved in DNA replication. It also inhibits the bcl-2 protein and the bcr-abl kinase, which are involved in apoptosis. Homoharringtonine has minimal toxicity and can induce apoptosis in cells with minimal cytotoxicity. This drug has shown significant cytotoxicity against myelogenous leukemia cells that have the BCR-ABL gene mutation. Homoharringtonine has synergistic effects when used with other chemotherapeutic drugs such as adriamycin or vincristin.
Synonyms	Cephalotaxine 4-methyl (2R)-2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate
Molecular Weight	545.62 g/mol
Molecular Formula	C29H39NO9
Canonical SMILES	CC(C)(CCC[C@@](CC(=O)OC)(C(=O)O[C@H]1[C@H]2C3=CC4=C(C=C3CCN5[C@@]2(CCC5)C=C1OC)OCO4)O)O
Storage	store at <-15℃
Harmonized Tariff Code	Switzerland: 29349999 - USA: 2934920000 - Slovakia: 2934999090 - UK: 2934999000 - China: 2934999099
MDL Number	MFCD05618221

Custom Q&A

What is the chemical name of Homoharringtonine?

The chemical name of Homoharringtonine is Cephalotaxine 4-methyl 2-hydroxy-2-(4-hydroxy-4-methylpentyl)butanedioate.

What is the molecular formula of Homoharringtonine?

The molecular formula of Homoharringtonine is C29H39NO9.

What is the melting point of Homoharringtonine?

The melting point of Homoharringtonine is 144-146°C.

What are the main plant sources of Homoharringtonine?

Homoharringtonine is derived from Cephalotaxus fortune, a plant found in China.

What are the pharmacological activities of Homoharringtonine?

Homoharringtonine mainly inhibits leukemia cell DNA and protein synthesis and has an effect on the kidney, liver, and lung.

What are the side effects of Homoharringtonine?

The side effects of Homoharringtonine can include gastrointestinal reactions, cardiac toxicity, bone marrow suppression, hair loss, and rash.

How is Homoharringtonine synthesized?

Homoharringtonine is synthesized using δ-methyl-δ-caprolactone and ethanol as starting materials through a series of chemical reactions.

What is the main analytical method used for the analysis of Homoharringtonine?

High-performance liquid chromatography (HPLC) is a commonly used method for the analysis of Homoharringtonine.

How is Homoharringtonine mainly administrated?

Homoharringtonine is mainly administered through intravenous injection.

What are the storage methods for Homoharringtonine?

Homoharringtonine should be stored at 2-8°C.

※ Please kindly note that our products are for research use only.