Humantenine

Catalog Number	ACM82375299
CAS Number	82375-29-9
Molecular Weight	354.4
InChI	InChI=1S/C21H26N2O3/c1-4-13-11-22(2)18-10-21(19-9-14(13)15(18)12-26-19)16-7-5-6-8-17(16)23(25-3)20(21)24/h4-8,14-15,18-19H,9-12H2,1-3H3/b13-4+/t14-,15-,18-,19+,21-/m0/s1
InChI Key	SJKRPUOXUNOPOP-YDAOCWKESA-N
Purity	95%+
Complexity	635
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	354.1943427
Heavy Atom Count	26
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	0
Isomeric SMILES	C/C=C/1\CN([C@H]2C[C@@]3([C@H]4C[C@@H]1[C@@H]2CO4)C5=CC=CC=C5N(C3=O)OC)C
Monoisotopic Mass	354.1943427
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	42 Ų

Custom Q&A

What is the chemical name of humantenine?

The chemical name of humantenine is Spiro[3H-indole-3,8'(7'H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3'-ethylidene-1',2',3',4',4'a,5',9',9'a-octahydro-1-methoxy-1'-methyl-, (3S,3'Z,4'R,4'aS,7'R,9'aS)-.

What is the CAS number of humantenine?

The CAS number of humantenine is 82375-29-9.

What is the molecular formula of humantenine?

The molecular formula of humantenine is C21H26N2O3.

What is the molecular weight of humantenine?

The molecular weight of humantenine is 354.44.

In what category of compounds does humantenine belong?

Humantenine belongs to the category of alkaloids.

What is the predicted boiling point of humantenine?

The predicted boiling point of humantenine is 480.1±55.0 °C.

What is the predicted density of humantenine?

The predicted density of humantenine is 1.27±0.1 g/cm3.

In what forms is humantenine soluble?

Humantenine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the form of humantenine?

Humantenine is in the form of powder.

What is the predicted pKa value of humantenine?

The predicted pKa value of humantenine is 8.22±0.20.

※ Please kindly note that our products are for research use only.