Humantenirine

Catalog Number	ACM82375302
CAS Number	82375-30-2
Synonyms	4-Demethyl-11-methoxyhumantenine
Molecular Weight	370.4
InChI	InChI=1S/C21H26N2O4/c1-4-12-10-22-17-9-21(19-8-14(12)15(17)11-27-19)16-6-5-13(25-2)7-18(16)23(26-3)20(21)24/h4-7,14-15,17,19,22H,8-11H2,1-3H3/b12-4+/t14-,15+,17+,19+,21+/m1/s1
InChI Key	ZORKKCARNQAZRJ-YHEJMRRESA-N
Purity	95%+
Complexity	652
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	5
Exact Mass	370.18925731
Heavy Atom Count	27
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C/1\CN[C@H]2C[C@@]3([C@@H]4C[C@H]1[C@@H]2CO4)C5=C(C=C(C=C5)OC)N(C3=O)OC
Monoisotopic Mass	370.18925731
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	60 Ų

Custom Q&A

What is the chemical name of the compound humantenirine?

The chemical name of the compound humantenirine is Spiro[3H-indole-3,8'(7'H)-[4,7]methanooxepino[4,3-b]pyridin]-2(1H)-one, 3'-ethylidene-1',2',3',4',4'a,5',9',9'a-octahydro-1,6-dimethoxy-, (3S,3'Z,4'R,4'aS,7'R,9'aS)-.

What is the CAS number of humantenirine?

The CAS number of humantenirine is 82375-30-2.

In which type of solvents is humantenirine soluble?

Humantenirine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

Where is humantenirine found naturally?

Humantenirine is found in the plant Humantenia nitens, which is found in Gabon, Africa.

What enzyme activities does humantenirine inhibit?

Humantenirine has been shown to have potent inhibition of enzyme activities and may have potential as an anti-inflammatory drug.

What is the chemical formula of humantenirine?

The chemical formula of humantenirine is C21H26N2O4.

What is the molecular weight of humantenirine?

The molecular weight of humantenirine is 370.44.

What is the appearance of humantenirine?

Humantenirine appears as colorless cubic crystals.

What is the melting point of humantenirine?

The melting point of humantenirine is 168-169°C.

Which plants contain humantenirine?

Humantenirine is found in Gelsemium sempervirens, Gelsemium elegans, and Gelsemium rankinii.

※ Please kindly note that our products are for research use only.