Huperzine A

Catalog Number	ACM120786187
CAS Number	120786-18-7
Synonyms	(+/-)-Huperzine A
IUPAC Name	1-Amino-13-ethylidene-11-methyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one
Molecular Weight	242.32
Molecular Formula	C15H18N2O
Canonical SMILES	CC=C1C2CC3=C(C1(CC(=C2)C)N)C=CC(=O)N3
InChI	InChI=1S/C15H18N2O/c1-3-11-10-6-9(2)8-15(11,16)12-4-5-14(18)17-13(12)7-10/h3-6,10H,7-8,16H2,1-2H3,(H,17,18)
InChI Key	ZRJBHWIHUMBLCN-UHFFFAOYSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	551
Exact Mass	242.141913202
Heavy Atom Count	18
Monoisotopic Mass	242.141913202
Topological Polar Surface Area	55.1Ų

Custom Q&A

What is the chemical formula of Huperzine A?

The chemical formula of Huperzine A is C15H18N2O.

What is the primary function of Huperzine A in the brain?

Huperzine A is an acetylcholinesterase inhibitor, which means it helps promote higher levels of acetylcholine in the brain.

How is Huperzine A used in traditional Chinese medicine?

Huperzine A has been used in traditional Chinese medicine to enhance memory and treat fever and inflammation.

What is the recommended dosage range for Huperzine A supplementation?

The recommended dosage range for Huperzine A supplementation is typically between 50 - 200 mcg daily.

What are some potential side effects of Huperzine A?

Some potential side effects of Huperzine A include nausea, diarrhea, and loss of appetite, especially when exceeding the recommended dosage.

How does Huperzine A support cognitive function?

Huperzine A supports cognitive function by increasing levels of acetylcholine in the brain, which plays a key role in cognitive function.

What are the benefits of using Huperzine A?

Huperzine A can help support learning and memory, as well as provide energy and stamina for mental focus.

What is the mode of action of Huperzine A in the brain?

Huperzine A is a reversible acetylcholinesterase inhibitor that crosses the blood-brain barrier and increases levels of acetylcholine in different areas of the brain.

How does Huperzine A relate to Alzheimer's disease?

Huperzine A has been used in the treatment of Alzheimer's disease, leading to significant improvements in memory and cognitive function in patients.

How often should Huperzine A be cycled or taken for optimal benefits?

Huperzine A supplementation is often recommended to be cycled, taking no more than 2-3 times per week, or taking a 1-week break for every 2 weeks of use.

※ Please kindly note that our products are for research use only.