Hydrocotarnine hydrobromide

Hydrocotarnine hydrobromide

Inquiry
Catalog Number ACM5985002-1
CAS Number 5985-00-2
Structure
Description Hydrocotarnine hydrobromide (HC) is a water-soluble drug that has been used as an anti-inflammatory agent and for the treatment of cancer. It has been shown to inhibit the activity of some enzymes in the body, including those that are responsible for the breakdown of proteins and fats. In addition, HC inhibits the production of inflammatory substances such as prostaglandin, leukotrienes, and histamine.
Molecular Weight 302.16 g/mol
Molecular Formula C12H16BrNO3
Canonical SMILES CN1CCC2=CC3=C(C(=C2C1)OC)OCO3.Br
Harmonized Tariff Code Switzerland: 29349999 - USA: 2934993900 - Slovakia: 2934999090 - UK: 2934999090 - China: 2934999099
MDL Number MFCD00058098
Custom Q&A

What is the chemical formula of Hydrocotarnine hydrobromide?

The chemical formula of Hydrocotarnine hydrobromide is C12H16BrNO3.

What is the molecular weight of Hydrocotarnine hydrobromide?

The molecular weight of Hydrocotarnine hydrobromide is 302.16.

Are there any synonyms for Hydrocotarnine hydrobromide?

Yes, the synonyms for Hydrocotarnine hydrobromide are HYDROCOTARNINE HYDROBROMDIE and HYDROCOTARNINE HYDROBROMIDE.

What is the chemical name of Hydrocotarnine hydrobromide?

The chemical name of Hydrocotarnine hydrobromide is Hydrocotarnine hydrobromide.

How many carbon atoms are present in Hydrocotarnine hydrobromide?

There are 12 carbon atoms present in Hydrocotarnine hydrobromide.

What is the role of hydrobromide in the compound?

Hydrobromide likely acts as a counter ion to the positively charged part of the molecule.

How is Hydrocotarnine hydrobromide commonly used?

Hydrocotarnine hydrobromide is commonly used in pharmaceuticals for its medicinal properties.

What is the significance of the bromine atom in Hydrocotarnine hydrobromide?

The bromine atom likely adds certain chemical properties to Hydrocotarnine hydrobromide that contribute to its functionality in pharmaceuticals.

※ Please kindly note that our products are for research use only.