Hydroquinidine

Hydroquinidine

Inquiry
Catalog Number ACM1435558-1
CAS Number 1435-55-8
Structure
Synonyms Dihydroquinidine
IUPAC Name (S)-[(2R,4S,5R)-5-Ethyl-1-azabicyclo[2.2.2]octan-2-yl]-(6-methoxyquinolin-4-yl)methanol
Molecular Weight 326.44
Molecular Formula C20H26N2O2
Canonical SMILES CCC1CN2CCC1CC2C(C3=C4C=C(C=CC4=NC=C3)OC)O
InChI InChI=1S/C20H26N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h4-6,8,11,13-14,19-20,23H,3,7,9-10,12H2,1-2H3/t13-,14-,19+,20-/m0/s1
InChI Key LJOQGZACKSYWCH-LHHVKLHASA-N
Purity 98%+
Storage Store in dry, low temperature, sealed, 2-8 °C.
Complexity 432
Exact Mass 326.199428076
Heavy Atom Count 24
Isomeric SMILES CC[C@H]1CN2CC[C@H]1C[C@@H]2[C@H](C3=C4C=C(C=CC4=NC=C3)OC)O
Monoisotopic Mass 326.199428076
Topological Polar Surface Area 45.6Ų
Custom Q&A

What is the chemical formula of Hydroquinidine?

The chemical formula of Hydroquinidine is C20H26N2O2.

What is the melting point of Hydroquinidine?

The melting point of Hydroquinidine is 169-170 °C.

What are the synonyms of Hydroquinidine?

Some synonyms of Hydroquinidine are Dihydroquinidine, Quinine Sulphate Impurity 1, and 10,11-Dihydroquinidine.

In what form does Hydroquinidine exist?

Hydroquinidine exists in the form of a crystalline solid.

What are the safety codes associated with Hydroquinidine?

The hazard code for Hydroquinidine is Xn, and the risk statements are 20/21/22.

What are the main uses of Hydroquinidine?

Hydroquinidine is used as an antiarrhythmic and antimalarial.

Are there any specific storage requirements for Hydroquinidine?

Yes, Hydroquinidine should be stored in a dark place, sealed in dry, and at room temperature.

What is the boiling point of Hydroquinidine?

The boiling point of Hydroquinidine is estimated to be 464.47°C.

How can Hydroquinidine be purified?

Hydroquinidine can be purified as it is slightly soluble in Et2O and H2O but readily soluble in hot EtOH.

What are the safety statements associated with Hydroquinidine?

The safety statements for Hydroquinidine are 36/37-36.

※ Please kindly note that our products are for research use only.