Hydroxy-gamma-isosanshool

Catalog Number	ACM127514629
CAS Number	127514-62-9
Synonyms	Hydroxyl-γ-isosanshool
Molecular Weight	289.4
InChI	InChI=1S/C18H27NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-17(20)19-16-18(2,3)21/h4-9,12-15,21H,10-11,16H2,1-3H3,(H,19,20)/b5-4+,7-6+,9-8+,13-12+,15-14+
InChI Key	CRPPMKFSMRODIQ-FMBIJHKPSA-N
Purity	95%+
Complexity	427
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	289.204179104
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C/C=C/C=C/CC/C=C/C=C/C(=O)NCC(C)(C)O
Monoisotopic Mass	289.204179104
PhysicalState	Powder
Rotatable Bond Count	9
Topological Polar Surface Area	49.3 Ų

Custom Q&A

What is the chemical name of hydroxyl-γ-isosanshool?

The chemical name is N-(2-hydroxyisobutyl)-2,4,8,10,12-tetradecapentaenamide.

What are synonyms for hydroxyl-γ-isosanshool?

Synonyms include Hydroxy-Gamma-Isosanshool.

What is the CAS number for hydroxyl-γ-isosanshool?

The CAS number is 127514-62-9.

What is the molecular formula of hydroxyl-γ-isosanshool?

The molecular formula is C18H27NO2.

What is the molecular weight of hydroxyl-γ-isosanshool?

The molecular weight is 289.41.

What is the predicted boiling point of hydroxyl-γ-isosanshool?

The predicted boiling point is 505.9±50.0 °C.

What is the predicted density of hydroxyl-γ-isosanshool?

The predicted density is 0.973±0.06 g/cm3.

What is the predicted pka value of hydroxyl-γ-isosanshool?

The predicted pka value is 14.55±0.29.

How is hydroxyl-γ-isosanshool defined in ChEBI?

It is defined as N-(2-Hydroxyisobutyl)-2,4,8,10,12-tetradecapentaenamide is a fatty amide.

What is the chemical structure of hydroxyl-γ-isosanshool?

The chemical structure is (2E,4E,8E,10E,12E)-N-(2-hydroxy-2-methylpropyl)-2,4,8,10,12-Tetradecapentaenamide.

※ Please kindly note that our products are for research use only.