Hydroxy-β-sanshool

Catalog Number	ACM97465695
CAS Number	97465-69-5
Synonyms	Hydroxy-beta-sanshool
Molecular Weight	263.37
InChI	InChI=1S/C16H25NO2/c1-4-5-6-7-8-9-10-11-12-13-15(18)17-14-16(2,3)19/h4-9,12-13,19H,10-11,14H2,1-3H3,(H,17,18)/b5-4+,7-6+,9-8+,13-12+
InChI Key	LHFKHAVGGJJQFF-UMYNZBAMSA-N
Purity	95%+
Complexity	363
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	263.18852904
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C/C=C/C=C/CC/C=C/C(=O)NCC(C)(C)O
Monoisotopic Mass	263.18852904
PhysicalState	Powder
Rotatable Bond Count	8
Topological Polar Surface Area	49.3 Ų

Custom Q&A

What is the chemical formula of Hydroxy-β-sanshool?

The chemical formula of Hydroxy-β-sanshool is C16H25NO2.

What is the molecular weight of Hydroxy-β-sanshool?

The molecular weight of Hydroxy-β-sanshool is 263.38.

What is the CAS number for Hydroxy-β-sanshool?

The CAS number for Hydroxy-β-sanshool is 97465-69-5.

What are the synonyms for Hydroxy-β-sanshool?

The synonyms for Hydroxy-β-sanshool include Hydroxy-beta-Sanshool and 2,6,8,10-Dodecatetraenamide.

What is the predicted boiling point of Hydroxy-β-sanshool?

The predicted boiling point of Hydroxy-β-sanshool is 471.5±45.0 °C.

What is the predicted density of Hydroxy-β-sanshool?

The predicted density of Hydroxy-β-sanshool is 0.973±0.06 g/cm3.

What is the predicted pka value of Hydroxy-β-sanshool?

The predicted pka value of Hydroxy-β-sanshool is 14.59±0.29.

What is the common use of Hydroxy-β-sanshool?

Hydroxy-β-sanshool is commonly used in the food industry to create a tingling or numbing sensation when consumed.

How is Hydroxy-β-sanshool synthesized?

Hydroxy-β-sanshool can be synthesized through chemical reactions involving specific starting materials and reaction conditions.

※ Please kindly note that our products are for research use only.