Hydroxyevodiamine

Hydroxyevodiamine

Inquiry
Catalog Number ACM1238433
CAS Number 1238-43-3
Structure
Synonyms 10-Hydroxyevodiamine
Molecular Weight 319.4
InChI InChI=1S/C19H17N3O2/c1-21-16-5-3-2-4-13(16)19(24)22-9-8-12-14-10-11(23)6-7-15(14)20-17(12)18(21)22/h2-7,10,18,20,23H,8-9H2,1H3
InChI Key XYSMNZWLVJYABK-UHFFFAOYSA-N
Melting Point 195 °C
Purity 98%+
Complexity 527
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 319.132076794
Heavy Atom Count 24
Hydrogen Bond Acceptor Count 3
Hydrogen Bond Donor Count 2
Monoisotopic Mass 319.132076794
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 59.6 Ų
Custom Q&A

What is the chemical formula of Hydroxyevodiamine?

The chemical formula of Hydroxyevodiamine is C19H17N3O2.

What is the molecular weight of Hydroxyevodiamine?

The molecular weight of Hydroxyevodiamine is 319.36.

What is the melting point of Hydroxyevodiamine?

The melting point of Hydroxyevodiamine is 195℃ (dec.) in ethanol.

In which solvents is Hydroxyevodiamine soluble?

Hydroxyevodiamine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the color of Hydroxyevodiamine?

The color of Hydroxyevodiamine is yellow.

What is the potential use of Hydroxyevodiamine?

Hydroxyevodiamine is an alkaloid with potential cytotoxicity against the proliferation of cancer cells.

What is the predicted boiling point of Hydroxyevodiamine?

The predicted boiling point of Hydroxyevodiamine is 618.4±55.0 °C.

What is the predicted pka value of Hydroxyevodiamine?

The predicted pka value of Hydroxyevodiamine is 11.88±0.20.

What is the form of Hydroxyevodiamine?

Hydroxyevodiamine is in powder form.

What is the EINECS number of Hydroxyevodiamine?

The EINECS number of Hydroxyevodiamine is 683-147-9.

※ Please kindly note that our products are for research use only.