9α-Hydroxymatrine

Catalog Number	ACM88509926
CAS Number	88509-92-6
IUPAC Name	(1R,2R,9S,15S,17S)-15-Hydroxy-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one
Molecular Weight	264.36
Molecular Formula	C15H24N2O2
Canonical SMILES	C1CC2C3CC(CN4C3C(CCC4)CN2C(=O)C1)O
InChI	InChI=1S/C15H24N2O2/c18-11-7-12-13-4-1-5-14(19)17(13)8-10-3-2-6-16(9-11)15(10)12/h10-13,15,18H,1-9H2/t10-,11-,12+,13+,15-/m0/s1
InChI Key	JTWPUVIWKODBID-WHPHWUKISA-N
Purity	97%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	386
Exact Mass	264.183778013
Heavy Atom Count	19
Isomeric SMILES	C1C[C@@H]2[C@H]3C[C@@H](CN4[C@H]3[C@@H](CCC4)CN2C(=O)C1)O
Monoisotopic Mass	264.183778013
Topological Polar Surface Area	43.8Ų

Custom Q&A

What is the chemical name of 9α-Hydroxymatrine?

The chemical name is 1H,5H,10H-Dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one, dodecahydro-2-hydroxy-, (2S,7aS,13aR,13bR,13cS)-.

What is the synonym for 9α-Hydroxymatrine?

The synonym is 9α-Hydroxymatrine.

What is the molecular formula of 9α-Hydroxymatrine?

The molecular formula is C15H24N2O2.

What is the molecular weight of 9α-Hydroxymatrine?

The molecular weight is 264.36 g/mol.

What is the boiling point of 9α-Hydroxymatrine?

The predicted boiling point is 445.3±45.0 °C.

What is the predicted density of 9α-Hydroxymatrine?

The predicted density is 1.25±0.1 g/cm3.

What is the predicted pKa value of 9α-Hydroxymatrine?

The predicted pKa is 14.61±0.20.

What are the stereochemistry configurations of 9α-Hydroxymatrine?

9α-Hydroxymatrine has the stereochemistry configurations (2S,7aS,13aR,13bR,13cS).

What is the structure of 9α-Hydroxymatrine?

The structure is 1H,5H,10H-Dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one with a dodecahydro-2-hydroxy group.

What is the chemical behavior or reactivity associated with 9α-Hydroxymatrine?

9α-Hydroxymatrine's chemical behavior or reactivity is not specified in the provided information.

※ Please kindly note that our products are for research use only.