Hydroxysanguinarine

Hydroxysanguinarine

Inquiry
Catalog Number ACM548301
CAS Number 548-30-1
Structure
Synonyms 13-Methyl[1,3]benzodioxolo[5,6-c][1,3]dioxolo[4,5-i]phenanthridine-14(13H)-one
Molecular Weight 347.3
InChI InChI=1S/C20H13NO5/c1-21-18-12(3-2-10-6-15-16(7-13(10)18)25-8-24-15)11-4-5-14-19(26-9-23-14)17(11)20(21)22/h2-7H,8-9H2,1H3
InChI Key UFHGABBBZRPRJV-UHFFFAOYSA-N
Melting Point 223-224 °C
Purity 95%+
Complexity 599
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 347.07937252
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 0
Monoisotopic Mass 347.07937252
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 57.2 Ų
Custom Q&A

What is the chemical name for Hydroxysanguinarine?

The chemical name for Hydroxysanguinarine is 13-Methyl[1,3]benzodioxolo[5,6-c][1,3]dioxolo[4,5-i]phenanthridine-14(13H)-one.

What are some synonyms for Hydroxysanguinarine?

Some synonyms for Hydroxysanguinarine are Oxosanguinarine, Oxysanguinarine, and 8-Oxosanguinarine.

What is the molecular formula of Hydroxysanguinarine?

The molecular formula of Hydroxysanguinarine is C20H13NO5.

What is the predicted boiling point of Hydroxysanguinarine?

The predicted boiling point of Hydroxysanguinarine is 628.7±55.0 °C.

How should Hydroxysanguinarine be stored?

Hydroxysanguinarine should be stored at -20°C.

What is the pka value of Hydroxysanguinarine?

The pka value of Hydroxysanguinarine is -1.58±0.20.

Where is Hydroxysanguinarine found naturally?

Hydroxysanguinarine is found in the roots of Sanguinaria canadensis.

How can Hydroxysanguinarine be prepared?

Hydroxysanguinarine can be prepared by oxidation of sanguinarine nitrate by potassium ferricyanide in alkaline solution.

What is the use of Hydroxysanguinarine?

Hydroxysanguinarine can be used to treat coronavirus infection.

What is the chemical classification of Hydroxysanguinarine?

Hydroxysanguinarine is classified as a benzophenanthridine alkaloid.

※ Please kindly note that our products are for research use only.