Hygrophylline

Catalog Number	ACM3573828
CAS Number	3573-82-8
Structure
Synonyms	(1S,14R)-1,2-Dihydro-12,14α-dihydroxysenecionan-11,16-dione
Molecular Weight	353.4
InChI	InChI=1S/C18H27NO6/c1-4-12-15(20)10(2)18(3,23)17(22)24-9-11-5-7-19-8-6-13(14(11)19)25-16(12)21/h4,10-11,13-15,20,23H,5-9H2,1-3H3/b12-4-
InChI Key	FAFYHPIEFKLDSP-QCDXTXTGSA-N
Melting Point	173-174 °C
Purity	95%+
Complexity	590
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	353.18383758
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	2
Isomeric SMILES	C/C=C\1/C(C(C(C(=O)OCC2CCN3C2C(CC3)OC1=O)(C)O)C)O
Monoisotopic Mass	353.18383758
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	96.3 Ų

Custom Q&A

What is the product name of CAS 3573-82-8?

The product name is (1S,14R)-1,2-Dihydro-12,14α-dihydroxysenecionan-11,16-dione.

What is another name for (1S,14R)-1,2-Dihydro-12,14α-dihydroxysenecionan-11,16-dione?

Another name for it is Hygrophylline.

What is the chemical formula of Hygrophylline?

The chemical formula is C18H27NO6.

What is the molecular weight of Hygrophylline?

The molecular weight is 353.42.

What is the melting point of Hygrophylline?

The melting point is 173-174°C.

What is the optical rotation of Hygrophylline?

The alpha D20 is -67.3° (c = 2.9 in ethanol).

What is the CAS number of Hygrophylline?

The CAS number is 3573-82-8.

In which solvent is the optical rotation of Hygrophylline measured?

The optical rotation is measured in ethanol.

What is the stereochemistry of Hygrophylline?

It has a (1S,14R) stereochemistry.

What type of compound is Hygrophylline?

Hygrophylline is a dione compound.

※ Please kindly note that our products are for research use only.