Hypaconitine

Catalog Number	ACM6900874
CAS Number	6900-87-4
Structure
Description	Hypaconitine is a cytosolic Ca2+ antagonist that can be used to study the mechanism of cardiac arrhythmias. Hypaconitine binds to the sarcoplasmic reticulum and blocks the release of Ca2+, which increases the concentration of intracellular Ca2+. This increase in intracellular Ca2+ inhibits cardiac contractility, leading to cardiac arrest. Hypaconitine has also been shown to inhibit growth factor-β1 (GF-β1). It has a chemical structure similar to aconitine, which is a toxic compound found in plants such as monkshood. Aconitine inhibits mitochondrial function by binding to polymerase chain reaction (PCR) DNA polymerase and blocking DNA synthesis. Hypaconitine also binds to PCR DNA polymerase and inhibits DNA synthesis, but does not inhibit mitochondrial function.
Synonyms	8-Acetoxy-13,15-dihydroxy-1,6,16-trimethoxy-4-(methoxymethyl)-20-methylaconitan-14-yl benzoate
Molecular Weight	615.71 g/mol
Molecular Formula	C33H45NO10
Canonical SMILES	CC(=O)O[C@@]12[C@@H]3[C@@H](C[C@@]([C@@H]3OC(=O)C4=CC=CC=C4)([C@H]([C@@H]1O)OC)O)[C@]56[C@H](CC[C@@]7([C@H]5[C@H]([C@H]2C6N(C7)C)OC)COC)OC
Storage	store at 2℃-8℃
Harmonized Tariff Code	Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939799090 - UK: 2939490000 - China: 2939799099

Custom Q&A

What is the chemical formula for Hypaconitine?

The chemical formula for Hypaconitine is C33H45NO10.

What is the melting point of Hypaconitine?

The melting point of Hypaconitine is 197-198°C.

What are some synonyms for Hypaconitine?

Some synonyms for Hypaconitine include Japaconitine B1, Japaconitine C, and Hypaconitine, from Aconitum carmichaeli.

What is the predicted boiling point of Hypaconitine?

The predicted boiling point of Hypaconitine is 671.3±55.0 °C.

What is the safety statement for Hypaconitine?

The safety statement for Hypaconitine is 24/25.

What is the use of Hypaconitine?

Hypaconitine is an Aconitine analog and a highly poisonous, neurotoxic alkaloid.

What is the packing group for Hypaconitine?

The packing group for Hypaconitine is I.

What is the solubility of Hypaconitine in DMF?

Hypaconitine has a solubility of 15mg/mL in DMF.

What is the pka value of Hypaconitine?

The pka value of Hypaconitine is 12.21±0.70.

What is the product category for Hypaconitine?

The product category for Hypaconitine includes pharmaceutical intermediate, phytochemical, and reference standards from Chinese medicinal herbs.

※ Please kindly note that our products are for research use only.