Hyperectine

Catalog Number	ACM94656469
CAS Number	94656-46-9
Synonyms	rel-3-Amino-4-[(5R,8'S)-6',7,8,8'-tetrahydro-6-methylspiro[1,3-dioxolo[4,5-g]isoquinoline-5(6H),7'-[7H]indeno[4,5-d][1,3]dioxol]-8'-yl]-1H-pyrrole-2,5-dione
Molecular Weight	447.4
InChI	InChI=1S/C24H21N3O6/c1-27-5-4-11-6-15-16(32-9-31-15)7-13(11)24(27)8-12-2-3-14-21(33-10-30-14)17(12)19(24)18-20(25)23(29)26-22(18)28/h2-3,6-7,19H,4-5,8-10H2,1H3,(H3,25,26,28,29)/t19-,24-/m0/s1
InChI Key	SPJFMVFHRMKUFD-CYFREDJKSA-N
Melting Point	237-238 °C
Purity	95%+
Complexity	924
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	447.1430354
Heavy Atom Count	33
Hydrogen Bond Acceptor Count	8
Hydrogen Bond Donor Count	2
Isomeric SMILES	CN1CCC2=CC3=C(C=C2[C@]14CC5=C([C@H]4C6=C(C(=O)NC6=O)N)C7=C(C=C5)OCO7)OCO3
Monoisotopic Mass	447.1430354
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	112 Ų

Custom Q&A

What is the predicted pka of Hyperectine?

The predicted pka of Hyperectine is 7.49±0.60.

What are some synonyms for Hyperectine?

Some synonyms for Hyperectine are rel-3-Amino-4-[(5R,8'S)-6',7,8,8'-tetrahydro-6-methylspiro[1,3-dioxolo[4,5-g]isoquinoline-5(6H),7'-[7H]indeno[4,5-d][1,3]dioxol]-8'-yl]-1H-pyrrole-2,5-dione.

What is the molecular formula of Hyperectine?

The molecular formula of Hyperectine is C24H21N3O6.

What is the molecular weight of Hyperectine?

The molecular weight of Hyperectine is 447.44 g/mol.

What is the melting point of Hyperectine?

The melting point of Hyperectine is 237-238 °C.

In which solvents is Hyperectine soluble?

Hyperectine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone.

What is the predicted boiling point of Hyperectine?

The predicted boiling point of Hyperectine is 605.4±55.0 °C.

What is the predicted density of Hyperectine?

The predicted density of Hyperectine is 1.60±0.1 g/cm3.

What form does Hyperectine typically come in?

Hyperectine typically comes in powder form.

※ Please kindly note that our products are for research use only.