Hyponine E

Catalog Number	ACM226975991
CAS Number	226975-99-1
Molecular Weight	920.9
InChI	InChI=1S/C45H48N2O19/c1-21-22(2)38(52)65-35-33(60-24(4)49)37(62-26(6)51)44(20-58-23(3)48)36(61-25(5)50)32(63-39(53)27-12-9-15-46-18-27)30-34(64-41(55)29-14-11-17-57-29)45(44,43(35,8)56)66-42(30,7)19-59-40(54)28-13-10-16-47-31(21)28/h9-18,21-22,30,32-37,56H,19-20H2,1-8H3/t21,22,30-,32-,33+,34-,35+,36-,37+,42+,43+,44-,45+/m1/s1
InChI Key	PMRSIAJYXABCTQ-IWYQQVOHSA-N
Purity	95%+
Complexity	1950
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	11
Exact Mass	920.28512731
Heavy Atom Count	66
Hydrogen Bond Acceptor Count	21
Hydrogen Bond Donor Count	1
Isomeric SMILES	CC1C(C(=O)O[C@H]2[C@@H]([C@@H]([C@]3([C@@H]([C@@H]([C@@H]4[C@H]([C@@]3([C@@]2(C)O)O[C@]4(COC(=O)C5=C1N=CC=C5)C)OC(=O)C6=CC=CO6)OC(=O)C7=CN=CC=C7)OC(=O)C)COC(=O)C)OC(=O)C)OC(=O)C)C
Monoisotopic Mass	920.28512731
PhysicalState	Powder
Rotatable Bond Count	15
Topological Polar Surface Area	279 Ų

Custom Q&A

What is the product name of the chemical compound with the synonym Hyponine E?

The product name is Hyponine E.

What are the synonyms of Hyponine E?

One of the synonyms of Hyponine E is 3-Pyridinecarboxylic acid.

What is the CAS number of Hyponine E?

The CAS number of Hyponine E is 226975-99-1.

What is the molecular formula of Hyponine E?

The molecular formula of Hyponine E is C45H48N2O19.

What is the molecular weight of Hyponine E?

The molecular weight of Hyponine E is 920.87.

What is the predicted boiling point of Hyponine E?

The predicted boiling point of Hyponine E is 913.2±65.0 °C.

What is the predicted density of Hyponine E?

The predicted density of Hyponine E is 1.45±0.1 g/cm3.

What is the predicted pka value of Hyponine E?

The predicted pka value of Hyponine E is 11.50±0.70.

From which plant is Hyponine E isolated?

Hyponine E is isolated from Tripterygium hypoglaucum.

How would you describe the chemical properties of Hyponine E based on the reference?

The chemical properties of Hyponine E include a predicted boiling point, density, and pka value.

※ Please kindly note that our products are for research use only.