Imperialine

Catalog Number	ACM61825987
CAS Number	61825-98-7
Structure
Synonyms	(5α,17β)-3β,20-Dihydroxycevan-6-one
Molecular Weight	429.6
InChI	InChI=1S/C27H43NO3/c1-15-4-7-25-27(3,31)21-6-5-17-18(20(21)14-28(25)13-15)11-22-19(17)12-24(30)23-10-16(29)8-9-26(22,23)2/h15-23,25,29,31H,4-14H2,1-3H3/t15-,16-,17+,18+,19-,20-,21+,22-,23+,25-,26+,27-/m0/s1
InChI Key	IQDIERHFZVCNRZ-LRCDAWNTSA-N
Melting Point	267 °C
Purity	95%+
Complexity	755
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	12
Exact Mass	429.32429423
Heavy Atom Count	31
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[C@H]1CC[C@H]2[C@@]([C@@H]3CC[C@@H]4[C@H]([C@@H]3CN2C1)C[C@H]5[C@H]4CC(=O)[C@@H]6[C@@]5(CC[C@@H](C6)O)C)(C)O
Monoisotopic Mass	429.32429423
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	60.8 Ų

Custom Q&A

What are some synonyms for Imperialine?

Sipeimine, 98%, from Fritillaria cirrhosa Don.; RADDEAMINE; (5α,17β)-3β,20-Dihydroxycevan-6-one; etc.

What is the CAS number for Imperialine?

61825-98-7

What is the molecular formula of Imperialine?

C27H43NO3

What is the molecular weight of Imperialine?

429.64

What is the melting point of Imperialine?

267 °C

What safety statement is associated with Imperialine?

Safety Statements 24/25

What is the usage of Imperialine?

Imperialine is an isosteroidal alkaloid from Fritillaria thunbergii.

What is the color of Imperialine?

White to Off-White

Where does Imperialine occur naturally?

Imperialine is a steroidal alkaloid isolated from the bulbs of Fritillaria irnperialis L. and Petiliurn eduardi.

What is the storage temperature recommended for Imperialine?

2-8°C

※ Please kindly note that our products are for research use only.