Indigo

Catalog Number	ACM482893
CAS Number	482-89-3
Structure
Synonyms	Delta(2,2’)-bipseudoindoxyl
IUPAC Name	2-(3-Hydroxy-1H-indol-2-yl)indol-3-one
Molecular Weight	262.26
Molecular Formula	C16H10N2O2
Canonical SMILES	C1=CC=C2C(=C1)C(=C(N2)C3=NC4=CC=CC=C4C3=O)O
InChI	InChI=1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17,19H
InChI Key	QQILFGKZUJYXGS-UHFFFAOYSA-N
Boiling Point	405.51 °C
Melting Point	>300 °C (lit.)
Purity	98%
Density	1.01 g/ml
Appearance	Blue powder
Complexity	448
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	262.074227566
Hazard Statements	Xi,Xn
Heavy Atom Count	20
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	2
Monoisotopic Mass	262.074227566
PhysicalState	Solid
Rotatable Bond Count	1
Topological Polar Surface Area	65.4 Ų

Custom Q&A

What is the molecular formula of Indigo?

The molecular formula of Indigo is C16H10N2O2.

What is the molecular weight of Indigo?

The molecular weight of Indigo is 262.26 g/mol.

How is the molecular weight of Indigo computed?

The molecular weight of Indigo is computed by PubChem 2.2.

What are some synonyms of Indigo?

Some synonyms of Indigo include INDIGO, Indigotin, Indigo Blue, and Vat blue 1.

In what form does Indigo occur in the solid state?

In the solid state, Indigo occurs in the trans form.

What is the IUPAC name of Indigo?

The IUPAC name of Indigo is 2-(3-hydroxy-1H-indol-2-yl)indol-3-one.

What is the InChIKey of Indigo?

The InChIKey of Indigo is QQILFGKZUJYXGS-UHFFFAOYSA-N.

How many hydrogen bond donor counts does Indigo have?

Indigo has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Indigo have?

Indigo has 3 hydrogen bond acceptor counts.

What is the exact mass of Indigo?

The exact mass of Indigo is 262.0742275.

※ Please kindly note that our products are for research use only.