Indole-3-carboxylic acid

Catalog Number	ACM771506
CAS Number	771-50-6
Structure
Synonyms	Indolecarboxylic acid
IUPAC Name	1H-Indole-3-carboxylic acid
Molecular Weight	161.16
Molecular Formula	C9H7NO2
Canonical SMILES	C1=CC=C2C(=C1)C(=CN2)C(=O)O
InChI	InChI=1S/C9H7NO2/c11-9(12)7-5-10-8-4-2-1-3-6(7)8/h1-5,10H,(H,11,12)
InChI Key	KMAKOBLIOCQGJP-UHFFFAOYSA-N
Boiling Point	287.44 °C
Melting Point	232-234 °C(lit.)
Flash Point	207.6 °C
Purity	98%
Density	1.2480 g/cm³
Appearance	Light beige powder
Storage	2-8 °C
Complexity	193
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	161.047678466
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	161.047678466
PhysicalState	Powder
Rotatable Bond Count	1
Topological Polar Surface Area	53.1 Ų

Custom Q&A

What is the chemical formula of indole-3-carboxylic acid?

The chemical formula of indole-3-carboxylic acid is C9H7NO2.

What is the molecular weight of indole-3-carboxylic acid?

The molecular weight of indole-3-carboxylic acid is 161.16 g/mol.

What is the melting point of indole-3-carboxylic acid?

The melting point of indole-3-carboxylic acid is 232-234 °C.

In what form is indole-3-carboxylic acid commonly found?

Indole-3-carboxylic acid is commonly found in the form of a light beige powder.

How is indole-3-carboxylic acid prepared?

Indole-3-carboxylic acid can be synthesized by the hydrolysis reaction of 3-trichloroacetyl indole.

What is the solubility of indole-3-carboxylic acid in 95% ethanol?

Indole-3-carboxylic acid is soluble in 95% ethanol at a concentration of 50 mg/ml.

What is the application of indole-3-carboxylic acid?

Indole-3-carboxylic acid is used as a specific and competitive inhibitor of the potentiation of glycine of NMDA-gated current.

What safety information is associated with indole-3-carboxylic acid?

Indole-3-carboxylic acid is considered an irritant and may pose risks to human health and safety.

What is the chemical property of indole-3-carboxylic acid?

Indole-3-carboxylic acid is a light beige crystalline powder that is soluble in ethanol and insoluble in boiling water and benzene.

What is the main target of indole-3-carboxylic acid?

The main target of indole-3-carboxylic acid is the 5-HT receptor.

※ Please kindly note that our products are for research use only.