Infractine

Catalog Number	ACM91147078
CAS Number	91147-07-8
Synonyms	9H-Pyrido[3,4-b]indole-1-propionic acid methyl ester
Molecular Weight	254.28
InChI	InChI=1S/C15H14N2O2/c1-19-14(18)7-6-13-15-11(8-9-16-13)10-4-2-3-5-12(10)17-15/h2-5,8-9,17H,6-7H2,1H3
InChI Key	IYWBIIGDWQBZJQ-UHFFFAOYSA-N
Purity	95%+
Complexity	334
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	254.105527694
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Monoisotopic Mass	254.105527694
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	55 Ų

Custom Q&A

What is the chemical formula of Infractine?

The chemical formula of Infractine is C15H14N2O2.

What is the molecular weight of Infractine?

The molecular weight of Infractine is 254.28.

What are some synonyms for Infractine?

Some synonyms for Infractine are 9H-Pyrido[3,4-b]indole-1-propionic acid methyl ester, Kumujanrine, Infractin, and 9H-Pyrido[3,4-b]indole-1-propanoic acid, methyl ester.

What is the boiling point of Infractine?

The boiling point of Infractine is predicted to be 452.1±30.0 °C.

What is the density of Infractine?

The density of Infractine is predicted to be 1.280±0.06 g/cm3.

What is the pka value of Infractine?

The pka value of Infractine is predicted to be 15.63±0.40.

What is the CAS number of Infractine?

The CAS number of Infractine is 91147-07-8.

※ Please kindly note that our products are for research use only.