Integerrimine

Catalog Number	ACM480795
CAS Number	480-79-5
Synonyms	Squalidine
Molecular Weight	335.4
InChI	InChI=1S/C18H25NO5/c1-4-12-9-11(2)18(3,22)17(21)23-10-13-5-7-19-8-6-14(15(13)19)24-16(12)20/h4-5,11,14-15,22H,6-10H2,1-3H3/b12-4+/t11-,14-,15-,18-/m1/s1
InChI Key	HKODIGSRFALUTA-IKZAEVNJSA-N
Melting Point	172 °C
Purity	95%+
Complexity	611
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	4
Exact Mass	335.1732729
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	6
Hydrogen Bond Donor Count	1
Isomeric SMILES	C/C=C/1\C[C@H]([C@@](C(=O)OCC2=CCN3[C@H]2[C@@H](CC3)OC1=O)(C)O)C
Monoisotopic Mass	335.1732729
PhysicalState	Powder
Rotatable Bond Count	0
Topological Polar Surface Area	76.1 Ų

Custom Q&A

What is the chemical name of Integerrimine?

The chemical name of Integerrimine is (15E)-12-Hydroxysenecionan-11,16-dione.

What are some synonyms for Integerrimine?

Some synonyms for Integerrimine include Squalidine, and (20E)-12-Hydroxysenecionan-11,16-dione.

What is the CAS number for Integerrimine?

The CAS number for Integerrimine is 480-79-5.

What is the molecular formula of Integerrimine?

The molecular formula of Integerrimine is C18H25NO5.

What is the melting point of Integerrimine?

The melting point of Integerrimine is 172°C.

What is the boiling point of Integerrimine (rough estimate)?

The boiling point of Integerrimine is estimated to be 472.03°C.

What is the density of Integerrimine (rough estimate)?

The density of Integerrimine is estimated to be 1.2250.

What is the refractive index of Integerrimine (estimate)?

The refractive index of Integerrimine is estimated to be 1.5100.

What is the LogP value of Integerrimine (est)?

The LogP value of Integerrimine is -1.504.

What is the usage of Integerrimine according to the reference?

Integerrimine is a pyrrolizidine alkaloid from Senecio leucanthemifolius poiret which displays antimicrobial activity.

※ Please kindly note that our products are for research use only.