Integerrimine-N-oxid

Integerrimine-N-oxid

Inquiry
Catalog Number ACM85955288
CAS Number 85955-28-8
Structure
Synonyms Integerrimine impurity 1
Molecular Weight 351.4
InChI InChI=1S/C18H25NO6/c1-4-12-9-11(2)18(3,22)17(21)24-10-13-5-7-19(23)8-6-14(15(13)19)25-16(12)20/h4-5,11,14-15,22H,6-10H2,1-3H3/b12-4+/t11-,14-,15-,18-,19/m1/s1
InChI Key PLGBHVNNYDZWGZ-NRTYDQPPSA-N
Purity 90%+
Complexity 656
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 4
Exact Mass 351.16818752
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 1
Isomeric SMILES C/C=C/1\C[C@H]([C@@](C(=O)OCC2=CC[N+]3([C@H]2[C@@H](CC3)OC1=O)[O-])(C)O)C
Monoisotopic Mass 351.16818752
PhysicalState Powder
Rotatable Bond Count 0
Topological Polar Surface Area 90.9 Ų
Custom Q&A

What is the chemical name of Integerrimin-N-oxid?

The chemical name of Integerrimin-N-oxid is Integerrimine-N-oxid.

What are some synonyms for Integerrimin-N-oxid?

Some synonyms for Integerrimin-N-oxid include Integerrimine-N-oxid and Integerrimine Impurity 1.

What is the CAS number for Integerrimin-N-oxid?

The CAS number for Integerrimin-N-oxid is 85955-28-8.

What is the molecular formula of Integerrimin-N-oxid?

The molecular formula of Integerrimin-N-oxid is C18H25NO6.

What is the molecular weight of Integerrimin-N-oxid?

The molecular weight of Integerrimin-N-oxid is 351.39.

What is the pka of Integerrimin-N-oxid?

The pka of Integerrimin-N-oxid is 12.77±0.40, as predicted.

What is the primary usage of Integerrimin-N-oxid?

Integerrimine N-oxide is a pyrrolizidione alkaloid from the genus Senecio with insecticidal properties.

What is the predicted pka of Integerrimin-N-oxid?

The predicted pka of Integerrimin-N-oxid is 12.77±0.40.

Which alkaloid class does Integerrimin-N-oxid belong to?

Integerrimin-N-oxid belongs to the pyrrolizidione alkaloid class.

Which genus does Integerrimin-N-oxid originate from?

Integerrimin-N-oxid is a pyrrolizidione alkaloid from the genus Senecio.

※ Please kindly note that our products are for research use only.