Isoabsouline

Catalog Number	ACM112513345
CAS Number	112513-34-5
Structure
Molecular Weight	286.37
InChI	InChI=1S/C17H22N2O2/c1-21-14-7-4-13(5-8-14)6-9-17(20)18-15-10-12-19-11-2-3-16(15)19/h4-9,15-16H,2-3,10-12H2,1H3,(H,18,20)/b9-6-/t15-,16+/m0/s1
InChI Key	SBFIICJNXKHXND-HPRJGHKQSA-N
Purity	95%+
Complexity	388
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	286.168127949
Heavy Atom Count	21
Hydrogen Bond Acceptor Count	3
Hydrogen Bond Donor Count	1
Isomeric SMILES	COC1=CC=C(C=C1)/C=C\C(=O)N[C@H]2CCN3[C@@H]2CCC3
Monoisotopic Mass	286.168127949
PhysicalState	Powder
Rotatable Bond Count	4
Topological Polar Surface Area	41.6 Ų

Custom Q&A

What is the chemical name of Isoabsouline?

The chemical name of Isoabsouline is 2-Propenamide, N-[(1S,7aR)-hexahydro-1H-pyrrolizin-1-yl]-3-(4-methoxyphenyl)-.

What are the synonyms of Isoabsouline?

The synonyms of Isoabsouline are Isoabsouline and (2Z)-2-Propenamide, N-[(1S,7aR)-hexahydro-1H-pyrrolizin-1-yl]-3-(4-methoxyphenyl)-.

What is the CAS number of Isoabsouline?

The CAS number of Isoabsouline is 112513-34-5.

What is the molecular formula of Isoabsouline?

The molecular formula of Isoabsouline is C17H22N2O2.

What is the molecular weight of Isoabsouline?

The molecular weight of Isoabsouline is 286.37.

What is the predicted boiling point of Isoabsouline?

The predicted boiling point of Isoabsouline is 510.4±50.0 °C.

What is the predicted density of Isoabsouline?

The predicted density of Isoabsouline is 1.17±0.1 g/cm3.

What is the predicted pka of Isoabsouline?

The predicted pka of Isoabsouline is 13.92±0.20.

Why is Isoabsouline important in chemical research?

Isoabsouline is important in chemical research because of its unique chemical properties and potential applications in various industries.

What further experiments or studies can be conducted on Isoabsouline?

Further experiments or studies can be conducted on Isoabsouline to investigate its reactivity, stability, and potential uses in pharmaceuticals, cosmetics, and other fields.

※ Please kindly note that our products are for research use only.