Isocorydine-1

Catalog Number	ACM475672-1
CAS Number	475-67-2
Structure
Description	Isocorydine is a bisbenzylisoquinoline alkaloid that has been shown to inhibit the growth of cancer cells. Isocorydine inhibits the production of ATP by binding to the enzyme protopine, which is involved in cellular energy production. It has also been shown to have anti-inflammatory and analgesic properties. Isocorydine binds to rat liver microsomes through intramolecular hydrogen bonding with amino acid residues on the surface of the enzyme, which prevents access of other drugs or substrates.
Synonyms	Luteanine
Molecular Weight	341.41 g/mol
Molecular Formula	C20H23NO4
Canonical SMILES	CN(CC1)[C@@]2([H])CC3=C(C(O)=C(OC)C=C3)C4=C2C1=CC(OC)=C4OC
Storage	store at 2℃-8℃, protect from light
Harmonized Tariff Code	Switzerland: 29339980 - Slovakia: 2939990090 -

Custom Q&A

What is the chemical formula of ISOCORYDINE HYDROCHLORIDE?

The chemical formula of ISOCORYDINE HYDROCHLORIDE is C20H23NO4.

What is the molecular weight of ISOCORYDINE HYDROCHLORIDE?

The molecular weight of ISOCORYDINE HYDROCHLORIDE is 341.4.

What is the melting point of ISOCORYDINE HYDROCHLORIDE?

The melting point of ISOCORYDINE HYDROCHLORIDE is 216-220 °C.

In what solvents is ISOCORYDINE HYDROCHLORIDE soluble?

ISOCORYDINE HYDROCHLORIDE is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, and Acetone, among others.

What is the predicted pKa of ISOCORYDINE HYDROCHLORIDE?

The predicted pKa of ISOCORYDINE HYDROCHLORIDE is 9.41±0.20.

What is the Safety Information classification of ISOCORYDINE HYDROCHLORIDE in WGK Germany?

ISOCORYDINE HYDROCHLORIDE is classified as WGK Germany 3.

What is a potential usage of ISOCORYDINE HYDROCHLORIDE?

ISOCORYDINE HYDROCHLORIDE is an alkaloid inhibitor of eukaryotic kinases.

What is one of the uses of ISOCORYDINE?

ISOCORYDINE has sedative and cholinergic properties.

What pharmacological effects are associated with ISOCORYDINE?

ISOCORYDINE has vasodilatory, anticancer, and cytotoxic effects.

What are the target receptors or enzymes affected by ISOCORYDINE?

The target receptors or enzymes affected by ISOCORYDINE include Dopamine Receptor and P450.

※ Please kindly note that our products are for research use only.