Isodomoic acid G

Catalog Number	ACM188346818
CAS Number	188346-81-8
Molecular Weight	311.33
InChI	InChI=1S/C15H21NO6/c1-8(4-3-5-9(2)14(19)20)11-7-16-13(15(21)22)10(11)6-12(17)18/h3-4,9-10,13,16H,5-7H2,1-2H3,(H,17,18)(H,19,20)(H,21,22)/b4-3+,11-8-/t9-,10+,13+/m1/s1
InChI Key	MKCCCBSBSRCARB-NMWGDLGCSA-N
Purity	95%+
Complexity	522
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	3
Exact Mass	311.13688739
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	7
Hydrogen Bond Donor Count	4
Isomeric SMILES	C[C@H](C/C=C/C(=C\1/CN[C@@H]([C@H]1CC(=O)O)C(=O)O)/C)C(=O)O
Monoisotopic Mass	311.13688739
PhysicalState	Powder
Rotatable Bond Count	7
Topological Polar Surface Area	124 Ų

Custom Q&A

What is the chemical formula for Isodomoic acid G?

The chemical formula for Isodomoic acid G is C15H21NO6.

What is the molecular weight of Isodomoic acid G?

The molecular weight of Isodomoic acid G is 311.33 g/mol.

What is the melting point of Isodomoic acid G?

The melting point of Isodomoic acid G is in the range of 181-183 °C, with decomposition.

What is the predicted boiling point of Isodomoic acid G?

The predicted boiling point of Isodomoic acid G is 609.7±55.0 °C.

What is the predicted density of Isodomoic acid G?

The predicted density of Isodomoic acid G is 1.285±0.06 g/cm3.

What is the predicted pka value of Isodomoic acid G?

The predicted pka value of Isodomoic acid G is 2.01±0.40.

How is Isodomoic acid G commonly known as?

Isodomoic acid G is also known as 3-Pyrrolidineacetic acid, 2-carboxy-4-[(2E,5R)-5-carboxy-1-methyl-2-hexen-1-ylidene]-, (2S,3S,4E)-.

What is the CAS number of Isodomoic acid G?

The CAS number of Isodomoic acid G is 188346-81-8.

How does Isodomoic acid G compare to other forms of Isodomoic acid chemically?

Isodomoic acid G has a unique chemical structure compared to other forms of Isodomoic acid.

※ Please kindly note that our products are for research use only.