Isoevodiamine

Isoevodiamine

Inquiry
Catalog Number ACM518183
CAS Number 518-18-3
Structure
Synonyms (+/-)-Evodiamine
Molecular Weight 303.4
InChI InChI=1S/C19H17N3O/c1-21-16-9-5-3-7-14(16)19(23)22-11-10-13-12-6-2-4-8-15(12)20-17(13)18(21)22/h2-9,18,20H,10-11H2,1H3
InChI Key TXDUTHBFYKGSAH-UHFFFAOYSA-N
Melting Point 272 °C
Purity 98%+
Complexity 495
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 303.137162174
Heavy Atom Count 23
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 1
Monoisotopic Mass 303.137162174
PhysicalState Solid
Rotatable Bond Count 0
Topological Polar Surface Area 39.3 Ų
Custom Q&A

What is the chemical formula of Evodiamine?

The chemical formula of Evodiamine is C19H17N3O.

What are the synonyms of Evodiamine?

The synonyms of Evodiamine include Indol(2',3':3,4)pyrido(2,1-b)quinazolin-5(7H)-one, 8,13,13b,14-tetrahydro-14-methyl-, (S)-; EvodiaMine(IsoevodiaMine); and more.

What is the melting point of Evodiamine?

The melting point of Evodiamine is 278°C.

In what form does Evodiamine appear?

Evodiamine appears as off-white to light yellow solid.

What pharmacological effects does Evodiamine have?

Evodiamine has various pharmacological effects including anti-tumor, protecting the heart, causing weight loss, anti-inflammatory, analgesic, and anti-senile dementia.

How is Evodiamine extracted from Evodia?

Evodiamine is extracted and isolated from the fruit of Rutaceae Evodia rutaecarpa (Juss.) Benth.

What is the traditional extraction method of Evodiamine?

The traditional extraction method of Evodiamine includes water extraction, ultrasonic extraction, and Soxhlet extraction.

What is the chemical synthesis pathway of Evodiamine?

N-methyl anthranilic acid is used as the starting material for the synthesis of Evodiamine.

How does Evodiamine impact the endocrine system?

Evodiamine can reduce the activity of intracellular cyclic adenosine monophosphate (cAMP)-related pathways and inhibit the activity of steroid-related enzymes, among other effects.

What effects does Evodiamine have on the cardiovascular system?

Evodiamine can impact heart rhythm, contraction force, blood pressure, and have hypotensive effects.

※ Please kindly note that our products are for research use only.