Isofebrifugine

Isofebrifugine

Inquiry
Catalog Number ACM32434449
CAS Number 32434-44-9
Structure
Synonyms 3-[[(3aS,7aS)-Octahydro-2-hydroxyfuro[3,2-b]pyridin-2-yl]methyl]-4(3H)-quinazolinone
Molecular Weight 301.34
InChI InChI=1S/C16H19N3O3/c20-15-11-4-1-2-5-12(11)18-10-19(15)9-16(21)8-13-14(22-16)6-3-7-17-13/h1-2,4-5,10,13-14,17,21H,3,6-9H2
InChI Key YLYLCQRQSRDSQR-UHFFFAOYSA-N
Melting Point 129-130 °C
Purity 90%+
Complexity 483
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 301.14264148
Heavy Atom Count 22
Hydrogen Bond Acceptor Count 5
Hydrogen Bond Donor Count 2
Monoisotopic Mass 301.14264148
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 74.2 Ų
Custom Q&A

What is the product name of the chemical compound with the synonym isofebrifugin?

The product name of the chemical compound with the synonym isofebrifugin is Isofebrifugin.

What is the molecular formula of isofebrifugin?

The molecular formula of isofebrifugin is C16H19N3O3.

What is the molecular weight of isofebrifugin?

The molecular weight of isofebrifugin is 301.34.

What is the melting point of isofebrifugin?

The melting point of isofebrifugin is 129-130 °C.

What is the predicted boiling point of isofebrifugin?

The predicted boiling point of isofebrifugin is 519.8±58.0 °C.

In what form should isofebrifugin be stored?

Isofebrifugin should be stored at -20°C.

What is the solubility of isofebrifugin?

Isofebrifugin is soluble in DMSO.

What is the predicted pka value of isofebrifugin?

The predicted pka value of isofebrifugin is 12.01±0.20.

What are some other names or synonyms of isofebrifugin?

Some other names or synonyms of isofebrifugin are alpha-Dichroine, cis-Febrifugine, and NSC 290495.

What is the chemical structure of isofebrifugin?

The chemical structure of isofebrifugin is 3-[(3aS,7aS)-2-Hydroxyperhydrofuro[3,2-b]pyridin-2-ylmethyl]-3,4-dihydroquinazolin-4-one.

※ Please kindly note that our products are for research use only.