Isomaculosidine

Catalog Number	ACM518967
CAS Number	518-96-7
Synonyms	6,8-Dimethoxy-9-methylfuro[2,3-b]quinolin-4-one
Molecular Weight	259.26
InChI	InChI=1S/C14H13NO4/c1-15-12-10(6-8(17-2)7-11(12)18-3)13(16)9-4-5-19-14(9)15/h4-7H,1-3H3
InChI Key	FXHBKLQQNAGNJN-UHFFFAOYSA-N
Melting Point	168-170 °C
Purity	95%+
Complexity	361
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	259.0844579
Heavy Atom Count	19
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	0
Monoisotopic Mass	259.0844579
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	51.9 Ų

Custom Q&A

What is the chemical formula of IsoMaculosidine?

The chemical formula of IsoMaculosidine is C14H13NO4.

What are the synonyms for IsoMaculosidine?

The synonyms for IsoMaculosidine are IsoMaculosidine; Furo[2,3-b]quinolin-4(9H)-one, 6,8-dimethoxy-9-methyl-; and 6,8-dimethoxy-9-methylfuro[2,3-b]quinolin-4-one.

What is the CAS number for IsoMaculosidine?

The CAS number for IsoMaculosidine is 518-96-7.

What is the molecular weight of IsoMaculosidine?

The molecular weight of IsoMaculosidine is 259.26 g/mol.

What is the melting point of IsoMaculosidine?

The melting point of IsoMaculosidine is 168-170℃.

Where does IsoMaculosidine occur naturally?

IsoMaculosidine occurs in the roots of Dictamnus albus.

What happens to IsoMaculosidine when exposed to light?

IsoMaculosidine turns red when exposed to light.

Is IsoMaculosidine considered a true alkaloid or an artifact?

IsoMaculosidine is considered a true alkaloid, not an artifact.

What is the pka value of IsoMaculosidine?

The pka value of IsoMaculosidine is 1.65±0.20.

Why is IsoMaculosidine difficult to obtain in crystalline form?

IsoMaculosidine is very hygroscopic, which makes it difficult to obtain in crystalline form.

※ Please kindly note that our products are for research use only.