Isomahanine

Isomahanine

Inquiry
Catalog Number ACM144606951
CAS Number 144606-95-1
Synonyms 3,11-Dihydro-3,8-dimethyl-3-(4-methyl-3-penten-1-yl)pyrano[3,2-a]carbazol-9-ol
Molecular Weight 347.4
InChI InChI=1S/C23H25NO2/c1-14(2)6-5-10-23(4)11-9-17-21(26-23)8-7-16-18-12-15(3)20(25)13-19(18)24-22(16)17/h6-9,11-13,24-25H,5,10H2,1-4H3
InChI Key WWXYBSVWYPHUPZ-UHFFFAOYSA-N
Purity 95%+
Complexity 581
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 347.18852904
Heavy Atom Count 26
Hydrogen Bond Acceptor Count 2
Hydrogen Bond Donor Count 2
Monoisotopic Mass 347.18852904
PhysicalState Powder
Rotatable Bond Count 3
Topological Polar Surface Area 45.2 Ų
Custom Q&A

What is the chemical name for ISOMAHANINE?

The chemical name for ISOMAHANINE is 3,11-Dihydro-3,8-dimethyl-3-(4-methyl-3-penten-1-yl)pyrano[3,2-a]carbazol-9-ol.

What are some synonyms for ISOMAHANINE?

Some synonyms for ISOMAHANINE include ISOMAHANINE and Pyrano[3,2-a]carbazol-9-ol, 3,11-dihydro-3,8-dimethyl-3-(4-methyl-3-penten-1-yl)-.

What is the CAS number for ISOMAHANINE?

The CAS number for ISOMAHANINE is 144606-95-1.

What is the molecular formula of ISOMAHANINE?

The molecular formula of ISOMAHANINE is C23H25NO2.

What is the molecular weight of ISOMAHANINE?

The molecular weight of ISOMAHANINE is 347.45.

What is the structure of ISOMAHANINE?

The structure of ISOMAHANINE is a pyrano[3,2-a]carbazol-9-ol with methyl and pentenyl groups attached.

How is ISOMAHANINE synthesized?

ISOMAHANINE can be synthesized through various chemical reactions involving carbazole and other organic compounds.

What are the potential applications of ISOMAHANINE?

ISOMAHANINE may have potential applications in pharmaceuticals, research, and as a chemical intermediate in organic synthesis.

What are the key properties of ISOMAHANINE that make it valuable in chemical research?

The unique structure and properties of ISOMAHANINE, such as its pyrano[3,2-a]carbazol-9-ol moiety and specific functional groups, make it valuable in chemical research and drug discovery processes.

※ Please kindly note that our products are for research use only.