Isomurrayafoline B

Catalog Number	ACM107903151
CAS Number	107903-15-1
Structure
Synonyms	7-Methoxy-3-methyl-8-(3-methyl-2-butenyl)-9H-carbazole-2-ol
Molecular Weight	295.4
InChI	InChI=1S/C19H21NO2/c1-11(2)5-6-14-18(22-4)8-7-13-15-9-12(3)17(21)10-16(15)20-19(13)14/h5,7-10,20-21H,6H2,1-4H3
InChI Key	XFLPKTCBCLWABD-UHFFFAOYSA-N
Purity	95%+
Complexity	418
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	295.157228913
Heavy Atom Count	22
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	2
Monoisotopic Mass	295.157228913
PhysicalState	Powder
Rotatable Bond Count	3
Topological Polar Surface Area	45.2 Ų

Custom Q&A

What is another name for Isomurrayafoline B?

Isomurrayafoline B is also known as 3-Methyl-7-methoxy-8-(3-methyl-2-butenyl)-9H-carbazol-2-ol.

What is the chemical formula for Isomurrayafoline B?

The chemical formula for Isomurrayafoline B is C19H21NO2.

What is the molecular weight of Isomurrayafoline B?

The molecular weight of Isomurrayafoline B is 295.38.

What is the CAS number for Isomurrayafoline B?

The CAS number for Isomurrayafoline B is 107903-15-1.

Where is Isomurrayafoline B extracted from?

Isomurrayafoline B is extracted from the stems and leaves of Clausena lenis.

What are the neuroprotective functions of Isomurrayafoline B?

Isomurrayafoline B has neuroprotective functions.

What is the specific chemical structure of Isomurrayafoline B?

The specific chemical structure of Isomurrayafoline B is 7-Methoxy-3-methyl-8-(3-methyl-2-butenyl)-9H-carbazole-2-ol.

What type of alkaloid is Isomurrayafoline B?

Isomurrayafoline B is a carbazole alkaloid.

Can Isomurrayafoline B be synthesized in a laboratory?

Isomurrayafoline B is extracted from natural sources and cannot be easily synthesized in a laboratory.

What is the potential use of Isomurrayafoline B in the medical field?

Isomurrayafoline B may have potential applications in neuroprotective treatments or therapies.

※ Please kindly note that our products are for research use only.